Molecule Details
| InChIKey | WKDBRCUUDXLTIM-NSHDSACASA-N |
|---|---|
| Compound Name | Amdizalisib |
| Canonical SMILES | C[C@H](Nc1ncnc(N)c1C#N)c1cc2ncc(Cl)n2nc1-c1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.38 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21514 |
|---|---|
| Drug Name | Amdizalisib |
| CAS Number | 1894229-05-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Amdizalisib is a small molecule drug. Amdizalisib is under investigation in clinical trial NCT05713110 (A Study of Tazemetostat in Combination With HMPL-689 in Patients With Relapsed/Refractory Lymphoma). Amdizalisib has a monoisotopic molecular weight of 390.11 Da. |
Cross-references: BindingDB: 350391 CHEMBL4438249 ZINC: ZINC000584641354
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O00329 | PIK3CD | Homo sapiens | Human | PF00454 PF00792 PF02192 PF00794 PF00613 | 9.5 | IC50 | ChEMBL;BindingDB |
| P27986 | PIK3R1 | Homo sapiens | Human | PF16454 PF00620 PF00017 | 9.5 | IC50 | ChEMBL;BindingDB |
| P48736 | PIK3CG | Homo sapiens | Human | PF00454 PF00792 PF00794 PF00613 PF19710 | 7.4 | IC50 | ChEMBL;BindingDB |
| O00459 | PIK3R2 | Homo sapiens | Human | PF16454 PF00620 PF00017 | 7.1 | IC50 | ChEMBL;BindingDB |