Molecule Details
| InChIKey | WGRQANOPCQRCME-PMACEKPBSA-N |
|---|---|
| Compound Name | Teneligliptin |
| Canonical SMILES | Cc1cc(N2CCN([C@@H]3CN[C@H](C(=O)N4CCSC4)C3)CC2)n(-c2ccccc2)n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.37 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11950 |
|---|---|
| Drug Name | Teneligliptin |
| CAS Number | 760937-92-6 |
| Groups | investigational |
| ATC Codes | A10BD28 A10BH08 |
| Description | Teneligliptin has been investigated for the treatment of Type 2 Diabetes Mellitus. |
Categories: Agents causing angioedema Alimentary Tract and Metabolism Blood Glucose Lowering Agents DPP-IV Inhibitors Drugs Used in Diabetes Sulfur Compounds Thiazoles
Cross-references: BindingDB: 50391565 ChEBI: 136042 CHEMBL2147777 ChemSpider: 10123963 PDB: M51 PubChem:11949652 PubChem:347828276 Wikipedia: Teneligliptin ZINC: ZINC000036520254
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P27487 | DPP4 | Dipeptidyl peptidase 4 | modulator | targets |