Molecule Details
| InChIKey | WDJUZGPOPHTGOT-XUDUSOBPSA-N |
|---|---|
| Compound Name | Digitoxin |
| Canonical SMILES | C[C@H]1O[C@@H](O[C@H]2[C@@H](O)C[C@H](O[C@H]3[C@@H](O)C[C@H](O[C@H]4CC[C@@]5(C)[C@H](CC[C@@H]6[C@@H]5CC[C@]5(C)[C@@H](C7=CC(=O)OC7)CC[C@]65O)C4)O[C@@H]3C)O[C@@H]2C)C[C@H](O)[C@@H]1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 11 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.37 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01396 |
|---|---|
| Drug Name | Digitoxin |
| CAS Number | 71-63-6 |
| Groups | approved withdrawn |
| ATC Codes | C01AA04 |
| Description | A cardiac glycoside sometimes used in place of digoxin. It has a longer half-life than digoxin; toxic effects, which are similar to those of digoxin, are longer lasting. (From Martindale, The Extra Pharmacopoeia, 30th ed, p665) |
Categories: Antiarrhythmic agents Carbohydrates Cardanolides Cardenolides Cardiac Glycosides Cardiac Therapy Cardiotonic Agents Cardiovascular Agents Compounds used in a research, industrial, or household setting Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates with a Narrow Therapeutic Index Cytochrome P-450 Substrates Digitalis Glycosides Enzyme Inhibitors Fused-Ring Compounds Glycosides Narrow Therapeutic Index Drugs P-glycoprotein substrates P-glycoprotein substrates with a Narrow Therapeutic Index Potential QTc-Prolonging Agents Protective Agents QTc Prolonging Agents Steroids
Cross-references: BindingDB: 46356 ChEBI: 28544 CHEMBL254219 ChemSpider: 389987 Drugs Product Database (DPD): 10107 C06955 D00297 PDB: F9R PharmGKB: PA449316 PubChem:441207 PubChem:46506035 RxCUI: 3403 Therapeutic Targets Database: DAP000120 Wikipedia: Digitoxin ZINC: ZINC000095862733
Target Activities (11)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P13637 | ATP1A3 | Homo sapiens | Human | PF13246 PF00689 PF00690 PF00122 | 8.1 | IC50 | ChEMBL |
| P54710 | FXYD2 | Homo sapiens | Human | PF02038 | 8.1 | IC50 | ChEMBL |
| Q13733 | ATP1A4 | Homo sapiens | Human | PF13246 PF00689 PF00690 PF00122 | 8.1 | IC50 | ChEMBL |
| P54709 | ATP1B3 | Homo sapiens | Human | PF00287 | 7.5 | Ki | ChEMBL;BindingDB |
| P05026 | ATP1B1 | Homo sapiens | Human | PF00287 | 7.5 | Ki | ChEMBL |
| P50993 | ATP1A2 | Homo sapiens | Human | PF13246 PF00689 PF00690 PF00122 | 7.5 | Ki | ChEMBL;BindingDB |
| P14415 | ATP1B2 | Homo sapiens | Human | PF00287 | 7.4 | Ki | ChEMBL;BindingDB |
| P05023 | ATP1A1 | Homo sapiens | Human | PF13246 PF00689 PF00690 PF00122 | 7.0 | Ki | ChEMBL;BindingDB |
| Q6ZQN7 | SLCO4C1 | Homo sapiens | Human | PF07648 PF03137 | 6.9 | IC50 | ChEMBL;BindingDB |
| P40763 | STAT3 | Homo sapiens | Human | PF00017 PF01017 PF02864 PF02865 PF21354 | 6.2 | IC50 | ChEMBL;BindingDB |
| P0DTD1 | rep | Severe acute respiratory syndrome coronavirus 2 | Pathogen | PF13087 PF16251 PF11501 PF12379 PF12124 PF11633 PF06471 PF06460 PF09401 PF20631 PF20633 PF20632 PF19215 PF19216 PF19219 PF19211 PF19218 PF16348 PF19217 PF19213 PF08716 PF08717 PF08710 PF08715 PF06478 PF01661 PF05409 PF00680 | 6.6 | IC50 | BindingDB |
DrugBank Target Actions (12)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P05108 | P05108 | Cholesterol side-chain cleavage enzyme, mitochondrial | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P05023 | ATP1A1 | Sodium/potassium-transporting ATPase subunit alpha-1 | inhibitor | targets |
| P05026 | ATP1B1 | Sodium/potassium-transporting ATPase subunit beta-1 | inhibitor | targets |
| P13637 | ATP1A3 | Sodium/potassium-transporting ATPase subunit alpha-3 | inhibitor | targets |
| P14415 | ATP1B2 | Sodium/potassium-transporting ATPase subunit beta-2 | inhibitor | targets |
| P50993 | ATP1A2 | Sodium/potassium-transporting ATPase subunit alpha-2 | inhibitor | targets |
| P54709 | ATP1B3 | Sodium/potassium-transporting ATPase subunit beta-3 | inhibitor | targets |
| P46721 | P46721 | Solute carrier organic anion transporter family member 1A2 | inhibitor | transporters |
| Q6ZQN7 | SLCO4C1 | Solute carrier organic anion transporter family member 4C1 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |