Molecule Details
| InChIKey | WANIDIGFXJFFEL-SANMLTNESA-N |
|---|---|
| Compound Name | Relacorilant |
| Canonical SMILES | Cn1cc(S(=O)(=O)N2CCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@]3(C(=O)c3cc(C(F)(F)F)ccn3)C2)cn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.15 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14976 |
|---|---|
| Drug Name | Relacorilant |
| CAS Number | 1496510-51-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Relacorilant is under investigation in clinical trial NCT02804750 (Study to Evaluate CORT125134 in Patients With Cushing's Syndrome). |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: CHEMBL4068611 ChemSpider: 57617720 Wikipedia: Relacorilant ZINC: ZINC000141949519
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P04150 | NR3C1 | Glucocorticoid receptor | antagonist | targets |