Molecule Details
| InChIKey | VRYMTAVOXVTQEF-UHFFFAOYSA-N |
|---|---|
| Compound Name | Moxisylyte |
| Canonical SMILES | CC(=O)Oc1cc(C(C)C)c(OCCN(C)C)cc1C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.5 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09205 |
|---|---|
| Drug Name | Moxisylyte |
| CAS Number | 54-32-0 |
| Groups | approved |
| ATC Codes | C04AX10 G04BE06 |
| Description | Moxisylyte, denominated as thymoxamine in the UK, is a specific and orally active α1-adrenergic antagonist.[T45] According to the WHO, moxisylyte is approved since 1987[T91] and in the same year, it acquired the denomination of orphan product by the FDA.[L1172] This drug was developed by the Japanes... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Amines Autonomic Agents Cardiovascular Agents Cholinesterase substrates Dimethylamines Drugs Used in Erectile Dysfunction Drugs that are Mainly Renally Excreted Genito Urinary System and Sex Hormones Methylamines Miotics Neurotransmitter Agents Peripheral Nervous System Agents Peripheral Vasodilators Sympatholytics Urologicals Vasodilating Agents
Cross-references: BindingDB: 50452139 ChEBI: 94754 CHEMBL159226 ChemSpider: 4110 D08239 PubChem:4260 PubChem:310265113 RxCUI: 10561 Wikipedia: Moxisylyte ZINC: ZINC000000057401
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 7.5 | Kd | ChEMBL |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 7.5 | Kd | ChEMBL |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 7.5 | Kd | ChEMBL |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 7.5 | Kd | ChEMBL |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 7.5 | Kd | ChEMBL |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 7.5 | Kd | ChEMBL |