Molecule Details
| InChIKey | VQYYQSZNRVQLIS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ningetinib |
| Canonical SMILES | Cc1c(C(=O)Nc2ccc(Oc3ccnc4cc(OCC(C)(C)O)ccc34)c(F)c2)c(=O)n(-c2ccccc2)n1C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.7 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16256 |
|---|---|
| Drug Name | Ningetinib |
| CAS Number | 1394820-69-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Ningetinib is under investigation in clinical trial NCT03758287 (Ningetinib (CT053PTSA) Plus Gefitinib in Stage IIIB or IV NSCLC Patients With EGFR Mutation and T790M Negative). |
Cross-references: BindingDB: 180270 CHEMBL3984441 ChemSpider: 61719564 ZINC: ZINC000143426755
Target Activities (3)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P30530 | AXL | Homo sapiens | Human | PF00041 PF13927 PF07714 | 8.0 | IC50 | ChEMBL;BindingDB |
| P08581 | MET | Homo sapiens | Human | PF07714 PF01437 PF01403 PF01833 | 7.7 | IC50 | ChEMBL;BindingDB |
| P35968 | KDR | Homo sapiens | Human | PF07679 PF00047 PF13895 PF22971 PF07714 PF21339 PF17988 PF22854 | 7.4 | IC50 | ChEMBL;BindingDB |