Molecule Details
| InChIKey | VPPJLAIAVCUEMN-GFCCVEGCSA-N |
|---|---|
| Compound Name | Lacosamide |
| Canonical SMILES | COC[C@@H](NC(C)=O)C(=O)NCc1ccccc1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 10 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.45 |
| Source | ChEMBL;BindingDB;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06218 |
|---|---|
| Drug Name | Lacosamide |
| CAS Number | 175481-36-4 |
| Groups | approved investigational |
| ATC Codes | N03AX18 |
| Description | Lacosamide is an antiepileptic drug used to treat seizures. As a chiral functionalized amino acid, it works by blocking slowly inactivating components of voltage-gated sodium currents. Lacosamide exhibits a stereoselective mode of interaction with sodium channels.[A262681] Lacosamide was first appro... |
Categories: Acetamides Acetates Acids, Acyclic Alkanes Amides Anti-epileptic Agent Anticonvulsants Bradycardia-Causing Agents Cardiovascular Agents Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates (strength unknown) Cytochrome P-450 Substrates Decreased Central Nervous System Disorganized Electrical Activity Hydrocarbons, Acyclic Membrane Transport Modulators Miscellaneous Anticonvulsants Nervous System Sodium Channel Blockers Voltage-Gated Sodium Channel Blockers
Cross-references: BindingDB: 50300204 ChEBI: 135939 CHEMBL58323 ChemSpider: 189902 Drugs Product Database (DPD): 20636 D07299 PDB: LQO PharmGKB: PA166160048 PubChem:219078 PubChem:175427063 RxCUI: 623400 Wikipedia: Lacosamide ZINC: ZINC000000007673
Target Activities (10)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q15858 | SCN9A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 6.7 | IC50 | ChEMBL;BindingDB |
| P00918 | CA2 | Homo sapiens | Human | PF00194 | 6.5 | Ki | ChEMBL;BindingDB |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 6.5 | pIC50 | TTD_MultiTarget |
| Q9Y2D0 | CA5B | Homo sapiens | Human | PF00194 | 6.5 | Ki | ChEMBL;BindingDB |
| Q16790 | CA9 | Homo sapiens | Human | PF00194 | 6.5 | Ki | ChEMBL;BindingDB |
| P00915 | CA1 | Homo sapiens | Human | PF00194 | 6.4 | Ki | ChEMBL;BindingDB |
| P07451 | CA3 | Homo sapiens | Human | PF00194 | 6.4 | Ki | ChEMBL;BindingDB |
| P23280 | CA6 | Homo sapiens | Human | PF00194 | 6.4 | Ki | ChEMBL;BindingDB |
| Q9ULX7 | CA14 | Homo sapiens | Human | PF00194 | 6.3 | Ki | ChEMBL;BindingDB |
| P22748 | CA4 | Homo sapiens | Human | PF00194 | 6.3 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| Q15858 | SCN9A | Sodium channel protein type 9 subunit alpha | blocker | targets |
| Q9NY46 | SCN3A | Sodium channel protein type 3 subunit alpha | blocker | targets |
| Q9Y5Y9 | SCN10A | Sodium channel protein type 10 subunit alpha | blocker | targets |
| Q9UI33 | SCN11A | Sodium channel protein type 11 subunit alpha | inhibitor | targets |
| Q16555 | Q16555 | Dihydropyrimidinase-related protein 2 | modulator | targets |