Molecule Details
| InChIKey | VPCSYAVXDAUHLT-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CC(C)c1cc(Oc2c(Br)cc(NC(=O)CC(=O)O)cc2Br)ccc1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.7 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05035 |
|---|---|
| Drug Name | Eprotirome |
| CAS Number | 355129-15-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Eprotirome which is a compound with promising properties for treatment of obesity and dyslipidemia. Eprotirome increases the body’s energy consumption and reduces body weight and markedly reduces blood lipids and blood glucose. |
Categories: Amides Amines Aniline Compounds
Cross-references: BindingDB: 50385105 CHEMBL2035874 ChemSpider: 8475344 PDB: 64L PubChem:10299876 PubChem:347827705 ZINC: ZINC000001494227