Molecule Details
| InChIKey | VOXZDWNPVJITMN-ZBRFXRBCSA-N |
|---|---|
| Compound Name | Estradiol |
| Canonical SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.19 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00783 |
|---|---|
| Drug Name | Estradiol |
| CAS Number | 50-28-2 |
| Groups | approved investigational vet_approved |
| ATC Codes | G03FA16 G03FA06 G03FA09 G03FA14 G03CA53 G03FA12 G03FB12 G03FB03 G03FA15 G03FB02 G03FB10 G03FA10 G03EA01 G03FA04 G03FB11 G03FA01 G03FB09 G03FB08 G03EA03 G03AA14 G03AB08 G03FB01 G03FA03 H01CC54 G03FA08 G03FB06 G03EA02 G03AA17 G03FA11 G03FB07 G03FA17 G03FA07 G03FA02 G03HB01 G03FB04 H01CC53 G03FA13 G02BB01 G03CA03 G03FA05 G03FB05 |
| Description | Estradiol is a naturally occurring hormone circulating endogenously in females. It is commercially available in several hormone therapy products for managing conditions associated with reduced estrogen, such as vulvovaginal atrophy and hot flashes. Some available forms of estradiol include oral tabl... |
Categories: Adrenal Cortex Hormones Androgens and Estrogens Anti-Gonadotropin-Releasing Hormones Antiandrogens and Estrogens BCRP/ABCG2 Inhibitors COMT Substrates Contraceptive Agents, Female Contraceptives, Oral Cytochrome P-450 CYP1A1 Substrates Cytochrome P-450 CYP1A2 Inhibitors Cytochrome P-450 CYP1A2 Inhibitors (weak) Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 CYP3A7 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Estradiol Congeners Estradiol, agonists Estranes Estrenes Estrogen Contraceptives Estrogens Estrogens, agonists Fused-Ring Compounds Genito Urinary System and Sex Hormones Gonadal Hormones Gonadal Steroid Hormones Hormonal Contraceptives for Systemic Use Hormones Hormones, Hormone Substitutes, and Hormone Antagonists Hyperglycemia-Associated Agents Hypothalamic Hormones Intravaginal Contraceptives Natural and Semisynthetic Estrogens, Plain OAT3/SLC22A8 Substrates OATP1B1/SLCO1B1 Inhibitors OCT2 Inhibitors P-glycoprotein substrates Pituitary and Hypothalamic Hormones and Analogues Progestogens and Estrogens, Sequential Preparations Sex Hormones and Modulators of the Genital System Steroids Systemic Hormonal Preparations, Excl. Sex Hormones and Insulins Thyroxine-binding globulin inducers UGT1A1 Substrates
Cross-references: BindingDB: 50005414 ChEBI: 16469 CHEMBL135 ChemSpider: 5554 Drugs Product Database (DPD): 7423 Guide to Pharmacology: 1013 IUPHAR: 1013 C00951 D00105 PDB: EST PharmGKB: PA449503 PubChem:5757 PubChem:46508115 RxCUI: 4083 Therapeutic Targets Database: DAP000854 Wikipedia: Estradiol_(medication) ZINC: ZINC000013520815
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q92731 | ESR2 | Homo sapiens | Human | PF12497 PF00104 PF00105 | 8.9 | IC50 | ChEMBL;BindingDB |
| P03372 | ESR1 | Homo sapiens | Human | PF12743 PF00104 PF02159 PF00105 | 8.9 | IC50 | ChEMBL;BindingDB |
| P11474 | ESRRA | Homo sapiens | Human | PF00104 PF00105 | 8.3 | IC50 | ChEMBL;BindingDB |
| O95718 | ESRRB | Homo sapiens | Human | PF00104 PF00105 | 8.3 | IC50 | ChEMBL;BindingDB |
| Q99527 | GPER1 | Homo sapiens | Human | PF00001 | 8.2 | Ki | ChEMBL;BindingDB |
| P04278 | SHBG | Homo sapiens | Human | PF00054 | 8.1 | IC50 | ChEMBL;BindingDB |
| P10275 | AR | Homo sapiens | Human | PF02166 PF00104 PF00105 | 7.7 | IC50 | ChEMBL;BindingDB |
| Q06278 | AOX1 | Homo sapiens | Human | PF01315 PF03450 PF00941 PF00111 PF01799 PF02738 PF20256 | 7.1 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (38)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P04278 | SHBG | Sex hormone-binding globulin | binder | carriers |
| P12104 | FABP2 | Fatty acid-binding protein, intestinal | binder | carriers |
| P22309 | UGT1A1 | UDP-glucuronosyltransferases (UGTs) | inducer | enzymes |
| P54855 | P54855 | UDP-glucuronosyltransferase 2B15 | inducer | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | inhibitor | enzymes |
| P11511 | CYP19A1 | Aromatase | product of | enzymes |
| P04798 | CYP1A1 | Cytochrome P450 1A1 | substrate | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P21964 | COMT | Catechol O-methyltransferase | substrate | enzymes |
| P22309 | UGT1A1 | UDP-glucuronosyltransferase 1A1 | substrate | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| Q16678 | CYP1B1 | Cytochrome P450 1B1 | substrate | enzymes |
| P03372 | ESR1 | Estrogen receptor | agonist | targets |
| Q92731 | ESR2 | Estrogen receptor beta | agonist | targets |
| O75469 | NR1I2 | Nuclear receptor subfamily 1 group I member 2 | binder | targets |
| P43681 | CHRNA4 | Neuronal acetylcholine receptor subunit alpha-4 | binder | targets |
| Q14457 | BECN1 | Beclin-1 | binder | targets |
| Q99527 | GPER1 | G-protein coupled estrogen receptor 1 | binder | targets |
| P00846 | MT-ATP6 | ATP synthase F(0) complex subunit a | inhibitor | targets |
| Q9NPD5 | SLCO1B3 | Solute carrier organic anion transporter family member 1B3 | binder | transporters |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | downregulator | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | downregulator | transporters |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | inhibitor | transporters |
| O75751 | SLC22A3 | Solute carrier family 22 member 3 | inhibitor | transporters |
| Q5T3U5 | Q5T3U5 | ATP-binding cassette sub-family C member 10 | inhibitor | transporters |
| Q9NSA0 | SLC22A11 | Solute carrier family 22 member 11 | inhibitor | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | inhibitor | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | regulator | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q8TCC7 | SLC22A8 | Organic anion transporter 3 | substrate | transporters |
| Q9NYB5 | Q9NYB5 | Solute carrier organic anion transporter family member 1C1 | substrate | transporters |