Molecule Details
| InChIKey | VKQFCGNPDRICFG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Nisoldipine |
| Canonical SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC(C)C)C1c1ccccc1[N+](=O)[O-] |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.26 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00401 |
|---|---|
| Drug Name | Nisoldipine |
| CAS Number | 63675-72-9 |
| Groups | approved |
| ATC Codes | C08CA07 |
| Description | Nisoldipine is a 1,4-dihydropyridine calcium channel blocker. It acts primarily on vascular smooth muscle cells by stabilizing voltage-gated L-type calcium channels in their inactive conformation. By inhibiting the influx of calcium in smooth muscle cells, nisoldipine prevents calcium-dependent smoo... |
Categories: Agents causing hyperkalemia Antiarrhythmic agents Antihypertensive Agents Antihypertensive Agents Indicated for Hypertension Bradycardia-Causing Agents Calcium Channel Blockers Calcium Channel Blockers (Dihydropyridine) Calcium-Regulating Hormones and Agents Cardiovascular Agents Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 CYP3A7 Substrates Cytochrome P-450 Substrates Decreased Blood Pressure Dihydropyridine Derivatives Dihydropyridines Drugs causing inadvertant photosensitivity Drugs that are Mainly Renally Excreted Hypotensive Agents Membrane Transport Modulators P-glycoprotein inhibitors Photosensitizing Agents Pyridines Selective Calcium Channel Blockers With Mainly Vascular Effects Vasodilating Agents
Cross-references: BindingDB: 642532 ChEBI: 76917 CHEMBL1726 ChemSpider: 4343 Guide to Pharmacology: 2524 IUPHAR: 2524 C07699 D00618 PharmGKB: PA450634 PubChem:4499 PubChem:46504546 RxCUI: 7435 Therapeutic Targets Database: DAP000595 Wikipedia: Nisoldipine
Target Activities (2)
DrugBank Target Actions (9)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | substrate | enzymes |
| P54289 | CACNA2D1 | Voltage-dependent calcium channel subunit alpha-2/delta-1 | inhibitor | targets |
| Q01668 | CACNA1D | Voltage-dependent L-type calcium channel subunit alpha-1D | inhibitor | targets |
| Q08289 | CACNB2 | Voltage-dependent L-type calcium channel subunit beta-2 | inhibitor | targets |
| Q13698 | CACNA1S | Voltage-dependent L-type calcium channel subunit alpha-1S | inhibitor | targets |
| Q13936 | CACNA1C | Voltage-dependent L-type calcium channel subunit alpha-1C | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |