Molecule Details
| InChIKey | VIUAUNHCRHHYNE-JTQLQIEISA-N |
|---|---|
| Compound Name | Pimasertib |
| Canonical SMILES | O=C(NC[C@H](O)CO)c1ccncc1Nc1ccc(I)cc1F |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.95 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14904 |
|---|---|
| Drug Name | Pimasertib |
| CAS Number | 1236699-92-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Pimasertib is under investigation in clinical trial NCT01378377 (Combination Trial of Pimasertib (MSC1936369B) With Temsirolimus). |
Categories: Nicotinic Acids Protein Kinase Inhibitors Pyridines
Cross-references: BindingDB: 50014412 ChEBI: 94793 CHEMBL2107832 ChemSpider: 24747378 PDB: QOA ZINC: ZINC000038226009
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q02750 | MAP2K1 | Mitogen-activated protein kinase kinase (MAPKK) | inhibitor | targets |