Molecule Details
| InChIKey | VHOZWHQPEJGPCC-AZXNYEMZSA-N |
|---|---|
| Compound Name | Pri-724 |
| Canonical SMILES | C[C@H]1[C@H]2N(C(=O)CN(C)N2C(=O)NCc2ccccc2)[C@@H](Cc2ccc(OP(=O)(O)O)cc2)C(=O)N1Cc1cccc2cccnc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.82 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15034 |
|---|---|
| Drug Name | Foscenvivint |
| CAS Number | 1198780-38-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | PRI-724 is under investigation in clinical trial NCT03620474 (Safety and Effectiveness of PRI-724 for Hepatitis C or B Virus Derived Liver Cirrhosis). |
Categories: Pyrimidines
Cross-references: ChemSpider: 64854018
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q92793 | CREBBP | CREB-binding protein | modulator | targets |