Molecule Details
| InChIKey | VGEXRDWWPSGZDH-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pf-03715455 |
| Canonical SMILES | CC(C)(C)c1cc(NC(=O)NCc2ccccc2Sc2ccc3nnc(-c4ccccc4SCCO)n3c2)n(-c2ccc(O)c(Cl)c2)n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.48 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12138 |
|---|---|
| Drug Name | PF-03715455 |
| CAS Number | 1056164-52-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | PF-03715455 has been used in trials studying the treatment of Asthma, Pulmonary Disease, Chronic Obstructive, and Chronic Obstructive Pulmonary Disease (COPD). |
Categories: Amides Anions Aza Compounds Electrolytes Heterocyclic Compounds, Fused-Ring Hydrogen Sulfide Ions Pyrazoles Sulfur Compounds p38 Mitogen-Activated Protein Kinases, antagonists & inhibitors
Cross-references: BindingDB: 50361467 CHEMBL1938400 ChemSpider: 9889301 PDB: YIS PubChem:11714580 PubChem:347828435
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q16539 | MAPK14 | Homo sapiens | Human | PF00069 | 12.0 | Kd | BindingDB |
| Q8N4C8 | MINK1 | Homo sapiens | Human | PF00780 PF00069 | 8.2 | IC50 | ChEMBL;BindingDB |
| Q15759 | MAPK11 | Homo sapiens | Human | PF00069 | 7.6 | IC50 | ChEMBL;BindingDB |
| P17948 | FLT1 | Homo sapiens | Human | PF07679 PF00047 PF13927 PF22971 PF07714 PF21339 PF17988 PF22854 | 6.0 | IC50 | ChEMBL;BindingDB |