Molecule Details
| InChIKey | VGBVAARMQYYITG-DESRROFGSA-N |
|---|---|
| Compound Name | Tridecactide |
| Canonical SMILES | CSCC[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)O)C(C)C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.56 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15687 |
|---|---|
| Drug Name | Tridecactide |
| CAS Number | 22006-64-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tridecactide, also known as alpha-corticotropin 1-13, is a deacetylated and deaminated alpha-melanocyte stimulating hormone, which may have antipyretic, anti-inflammatory, and antimicrobial effects.[A203210] Tridecactide, along with [metenkefalin], are under investigation as an immunomodulatory ther... |
Categories: Experimental Unapproved Treatments for COVID-19 Melanocyte-Stimulating Hormones
Cross-references: ChemSpider: 17287850