Molecule Details
| InChIKey | VCKUSRYTPJJLNI-UHFFFAOYSA-N |
|---|---|
| Compound Name | Terazosin |
| Canonical SMILES | COc1cc2nc(N3CCN(C(=O)C4CCCO4)CC3)nc(N)c2cc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.56 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01162 |
|---|---|
| Drug Name | Terazosin |
| CAS Number | 63590-64-7 |
| Groups | approved investigational |
| ATC Codes | G04CA03 |
| Description | Terazosin is a quinazoline derivative alpha-1-selective adrenergic blocking agent indicated for benign prostatic hyperplasia and hypertension[FDA Label][A176831]. Terazosin blocks adrenaline's action on alpha-1 adrenergic receptors, causing relaxation of smooth muscle in blood vessels and the prosta... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Antihypertensive Agents Antihypertensive Agents Indicated for Hypertension Drugs Used in Benign Prostatic Hypertrophy Genito Urinary System and Sex Hormones Genitourinary Agents Heterocyclic Compounds, Fused-Ring Hypotensive Agents Neurotransmitter Agents P-glycoprotein inhibitors Peripheral alpha-1 blockers Quinazolines Urological Agents Urologicals
Cross-references: BindingDB: 50033111 ChEBI: 9445 CHEMBL611 ChemSpider: 5208 Drugs Product Database (DPD): 11368 C07127 D08569 PharmGKB: PA451612 PubChem:5401 PubChem:46509129 RxCUI: 37798 Therapeutic Targets Database: DAP000371 Wikipedia: Terazosin
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 8.7 | Ki | ChEMBL;BindingDB |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 8.5 | Ki | ChEMBL;BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 8.2 | Ki | ChEMBL;BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 7.1 | Ki | ChEMBL;BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.7 | Ki | ChEMBL;BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P25100 | ADRA1D | Alpha-1D adrenergic receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1A adrenergic receptor | antagonist | targets |
| P35368 | ADRA1B | Alpha-1B adrenergic receptor | antagonist | targets |
| P01137 | TGFB1 | Transforming growth factor beta-1 proprotein | inducer | targets |
| Q12809 | KCNH2 | Voltage-gated inwardly rectifying potassium channel KCNH2 | inhibitor | targets |
| Q9H252 | KCNH6 | Voltage-gated inwardly rectifying potassium channel KCNH6 | inhibitor | targets |
| Q9NS40 | KCNH7 | Voltage-gated inwardly rectifying potassium channel KCNH7 | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |