Molecule Details
| InChIKey | VCFBPAOSTLMYIV-SANMLTNESA-N |
|---|---|
| Compound Name | Tranimilast |
| Canonical SMILES | CS(=O)(=O)Nc1ccc(C(=O)O[C@@H](Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1OCC1CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 10.4 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12800 |
|---|---|
| Drug Name | Tanimilast |
| CAS Number | 1239278-59-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | CHF6001 has been used in trials studying the treatment of Asthma and Chronic Obstructive Pulmonary Disease. |
Categories: Acids, Carbocyclic Amides Aminobenzoates Benzene Derivatives Benzoates Sulfones Sulfur Compounds
Cross-references: CHEMBL3113974 ChemSpider: 31137693 PubChem:70662473 PubChem:347828976 ZINC: ZINC000150603137
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 10.4 | IC50 | ChEMBL |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 10.4 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 10.4 | IC50 | ChEMBL |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 10.4 | IC50 | ChEMBL |