Molecule Details
| InChIKey | VAYOSLLFUXYJDT-RDTXWAMCSA-N |
|---|---|
| Compound Name | (+)-Lysergic acid diethylamide |
| Canonical SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 19 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.56 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04829 |
|---|---|
| Drug Name | Lysergic acid diethylamide |
| CAS Number | 50-37-3 |
| Groups | illicit investigational |
| ATC Codes | nan |
| Description | Debate continues over the nature and causes of chronic flashbacks. Explanations in terms of LSD physically remaining in the body for months or years after consumption have been discounted by experimental evidence. Some say HPPD is a manifestation of post-traumatic stress disorder, not related to the... |
Categories: Agents that produce hypertension Alkaloids Antidepressive Agents Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Ergolines Ergot Alkaloids and Derivatives Hallucinogens Heterocyclic Compounds, Fused-Ring Lysergic Acid Neurotransmitter Agents Psychotropic Drugs Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 5-HT2 Receptor Agonists Serotonin Agents Serotonin Receptor Agonists Serotonin Receptor Antagonists
Cross-references: BindingDB: 50241702 ChEBI: 6605 CHEMBL263881 ChemSpider: 5558 Guide to Pharmacology: 219 IUPHAR: 219 C07542 PDB: 7LD PubChem:5761 PubChem:46506397 Wikipedia: Lysergic_acid_diethylamide ZINC: ZINC000096903803
Target Activities (19)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 9.0 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.5 | Ki | ChEMBL;BindingDB |
| P28221 | HTR1D | Homo sapiens | Human | PF00001 | 8.4 | Ki | ChEMBL;BindingDB |
| P28222 | HTR1B | Homo sapiens | Human | PF00001 | 8.4 | Ki | BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 8.2 | Ki | ChEMBL;BindingDB |
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 8.2 | Ki | ChEMBL;BindingDB |
| P47898 | HTR5A | Homo sapiens | Human | PF00001 | 8.1 | Ki | ChEMBL;BindingDB |
| P23786 | CPT2 | Homo sapiens | Human | PF00755 | 7.6 | Ki | BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 7.6 | Ki | ChEMBL;BindingDB |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 7.5 | Ki | ChEMBL;BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 7.5 | Ki | ChEMBL;BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 7.3 | Ki | BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 7.2 | Ki | ChEMBL;BindingDB |
| P28566 | HTR1E | Homo sapiens | Human | PF00001 | 7.0 | Ki | ChEMBL;BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL;BindingDB |
| P08588 | ADRB1 | Homo sapiens | Human | PF00001 | 6.8 | Ki | ChEMBL;BindingDB |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 6.8 | Ki | BindingDB |
| P21918 | DRD5 | Homo sapiens | Human | PF00001 | 6.5 | Ki | ChEMBL;BindingDB |
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P41595 | HTR2B | 5-hydroxytryptamine receptor 2B | agonist | targets |
| P50406 | HTR6 | 5-hydroxytryptamine receptor 6 | binder | targets |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | inhibitor | targets |
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | inhibitor | targets |