Molecule Details
| InChIKey | VAYJLOGCWOXMAS-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | COc1cc(C(=O)N(C(C)C)C(C)C)ccc1OCCCCCOc1ccc(C(=N)N)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.7 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19718 |
|---|---|
| Drug Name | Moxilubant |
| CAS Number | 146978-48-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Moxilubant is a small molecule drug. The usage of the INN stem '-lubant' in the name indicates that Moxilubant is a leukotriene B4 receptor antagonist. Moxilubant has a monoisotopic molecular weight of 455.28 Da. |
Cross-references: BindingDB: 50052021 CHEMBL89326 ZINC: ZINC000003786875