Molecule Details
| InChIKey | VAPSMQAHNAZRKC-PQWRYPMOSA-N |
|---|---|
| Compound Name | Epristeride |
| Canonical SMILES | CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C=C(C(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.8 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19810 |
|---|---|
| Drug Name | Epristeride |
| CAS Number | 119169-78-7 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Epristeride is a small molecule drug. The usage of the INN stem '-steride' in the name indicates that Epristeride is a androgen/anabolic steroid. Epristeride has a monoisotopic molecular weight of 399.28 Da. |
Categories: 5-alpha Reductase Inhibitors Androstanes Androstenes Enzyme Inhibitors Fused-Ring Compounds Hormone Antagonists Hormones, Hormone Substitutes, and Hormone Antagonists Steroid Synthesis Inhibitors Steroids
Cross-references: BindingDB: 50043604 ChEBI: 31552 CHEMBL138225 ZINC: ZINC000003796232