Molecule Details
| InChIKey | UYNVMODNBIQBMV-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ifenprodil |
| Canonical SMILES | CC(C(O)c1ccc(O)cc1)N1CCC(Cc2ccccc2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.24 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08954 |
|---|---|
| Drug Name | Ifenprodil |
| CAS Number | 23210-56-2 |
| Groups | approved investigational withdrawn |
| ATC Codes | C04AX28 |
| Description | N-methyl-D-aspartate (NMDA) receptors (NMDARs) are members of the ionotropic glutamate receptor family, with key roles in brain development and neurological function.[A220118, A220128] NMDARs are heterotetramers that typically involve a dimer of dimers of both GluN1 and GluN2A-D subunits, with each ... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Anti-Parkinson Drugs Anticonvulsants Cardiovascular Agents Central Nervous System Depressants Excitatory Amino Acid Agents Excitatory Amino Acid Antagonists Experimental Unapproved Treatments for COVID-19 NMDA Receptor Antagonists Neurotransmitter Agents Peripheral Vasodilators Vasodilating Agents
Cross-references: BindingDB: 50083351 ChEBI: 93829 CHEMBL305187 ChemSpider: 3561 D08064 PubChem:3689 PubChem:310264919 RxCUI: 27403 Wikipedia: Ifenprodil
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 8.4 | IC50 | ChEMBL |
| Q13224 | GRIN2B | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 7.9 | IC50 | ChEMBL |
| Q12809 | KCNH2 | Homo sapiens | Human | PF00027 PF00520 PF13426 | 7.0 | IC50 | ChEMBL |
| Q05586 | GRIN1 | Homo sapiens | Human | PF01094 PF00060 PF10613 | 6.9 | IC50 | ChEMBL |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 6.0 | IC50 | ChEMBL |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P48051 | KCNJ6 | G protein-activated inward rectifier potassium channel 2 | antagonist | targets |
| P48544 | KCNJ5 | G protein-activated inward rectifier potassium channel 4 | antagonist | targets |
| P48549 | KCNJ3 | G protein-activated inward rectifier potassium channel 1 | antagonist | targets |
| Q05586 | GRIN1 | Glutamate receptor ionotropic, NMDA 1 | antagonist | targets |
| Q13224 | GRIN2B | Glutamate receptor ionotropic, NMDA 2B | antagonist | targets |
| Q9UNI1 | CELA1 | Chymotrypsin-like elastase family member 1 | inhibitor | targets |