Molecule Details
| InChIKey | UVSMNLNDYGZFPF-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pomalidomide |
| Canonical SMILES | Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.17 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08910 |
|---|---|
| Drug Name | Pomalidomide |
| CAS Number | 19171-19-8 |
| Groups | approved investigational |
| ATC Codes | L04AX06 |
| Description | Pomalidomide, an analogue of thalidomide, is an immunomodulatory antineoplastic agent. FDA approved on February 8, 2013. |
Categories: Acids, Carbocyclic Angiogenesis Inhibitors Angiogenesis Modulating Agents Antineoplastic Agents Antineoplastic and Immunomodulating Agents Cancer immunotherapy Central Nervous System Depressants Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP1A2 Substrates with a Narrow Therapeutic Index Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates with a Narrow Therapeutic Index Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Growth Inhibitors Growth Substances Heterocyclic Compounds, Fused-Ring Imides Immunologic Factors Immunosuppressive Agents Immunotherapy Isoindoles Myelosuppressive Agents Narrow Therapeutic Index Drugs P-glycoprotein substrates P-glycoprotein substrates with a Narrow Therapeutic Index Phthalic Acids Phthalimides Piperidines Piperidones Thalidomide Analog Tumor Necrosis Factor Blockers
Cross-references: BindingDB: 65456 ChEBI: 72690 CHEMBL43452 ChemSpider: 118785 Drugs Product Database (DPD): 22238 D08976 PubChem:134780 PubChem:175427148 RxCUI: 1369713 Wikipedia: Pomalidomide
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q14676 | MDC1 | Homo sapiens | Human | PF16589 PF00498 PF16770 | 7.5 | IC50 | BindingDB |
| P01375 | TNF | Homo sapiens | Human | PF00229 | 7.5 | IC50 | ChEMBL;BindingDB |
| P01584 | IL1B | Homo sapiens | Human | PF00340 PF02394 | 7.3 | IC50 | ChEMBL;BindingDB |
| P05231 | IL6 | Homo sapiens | Human | PF00489 | 7.2 | IC50 | BindingDB |
| Q16531 | DDB1 | Homo sapiens | Human | PF10433 PF23726 PF03178 | 7.2 | IC50 | ChEMBL;BindingDB |
| Q96SW2 | CRBN | Homo sapiens | Human | PF02190 PF03226 | 6.8 | IC50 | ChEMBL |
| P10147 | CCL3 | Homo sapiens | Human | PF00048 | 6.6 | IC50 | BindingDB |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P01375 | TNF | Tumor necrosis factor | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |
| Q96SW2 | CRBN | Protein cereblon | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |