Molecule Details
| InChIKey | UUDPUQDMSHQSKH-NSHDSACASA-N |
|---|---|
| Compound Name | Elzovantinib |
| Canonical SMILES | CCN1Cc2c(ccc(F)c2C#N)O[C@@H](C)CNC(=O)c2c(N)nn3ccc1nc23 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.15 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB18918 |
|---|---|
| Drug Name | Elzovantinib |
| CAS Number | 2271119-26-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Elzovantinib is under investigation in clinical trial NCT03993873 (Study of TPX-0022 in Patients With Advanced NSCLC, Gastric Cancer or Solid Tumors Harboring Genetic Alterations in MET). |
Cross-references: ChemSpider: 72380105 PDB: IYC
Target Activities (3)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08581 | MET | Homo sapiens | Human | PF07714 PF01437 PF01403 PF01833 | 9.3 | IC50 | ChEMBL;BindingDB |
| P07333 | CSF1R | Homo sapiens | Human | PF00047 PF25305 PF07714 | 9.1 | IC50 | ChEMBL;BindingDB |
| P12931 | SRC | Homo sapiens | Human | PF07714 PF00017 PF00018 | 9.0 | IC50 | ChEMBL;BindingDB |