Molecule Details
| InChIKey | USGHRRVFKSLEJT-WVBUVRCRSA-N |
|---|---|
| Compound Name | Nxl 101 |
| Canonical SMILES | COc1ccc2ncc(F)c([C@@H](O)CC[C@@H]3CCN(CCSc4cccs4)C[C@@H]3C(=O)O)c2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.6 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19549 |
|---|---|
| Drug Name | Viquidacin |
| CAS Number | 904302-98-3 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Viquidacin is a small molecule drug. The usage of the INN stem '-dacin' in the name indicates that Viquidacin is a antibiotic, DNA gyrase and topoisomerase IV inhibitor. Viquidacin has a monoisotopic molecular weight of 504.16 Da. |
Categories: Amino Acids, Peptides, and Proteins Peptides Peptides, Cyclic Pharmaceutical Preparations Streptogramin Group A Streptogramin Group B Streptogramins
Cross-references: BindingDB: 50393503 CHEMBL2158050 ZINC: ZINC000009132595
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P0A0K8 | gyrB | Staphylococcus aureus | Pathogen | PF00204 PF00986 PF02518 PF01751 | 6.7 | IC50 | ChEMBL |
| P20831 | gyrA | Staphylococcus aureus | Pathogen | PF03989 PF00521 | 6.7 | IC50 | ChEMBL;BindingDB |
| P0C1S7 | parE | Staphylococcus aureus | Pathogen | PF00204 PF00986 PF02518 PF01751 | 6.5 | IC50 | ChEMBL |
| P0C1U9 | parC | Staphylococcus aureus | Pathogen | PF03989 PF00521 | 6.5 | IC50 | ChEMBL |