Molecule Details
| InChIKey | UQABYHGXWYXDTK-UUOKFMHZSA-N |
|---|---|
| Compound Name | Guanosine 5'-(Beta,Gamma-Imido)Triphosphate |
| Canonical SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)NP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.11 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB02082 |
|---|---|
| Drug Name | Phosphoaminophosphonic acid guanylate ester |
| CAS Number | 34273-04-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | A non-hydrolyzable analog of GTP, in which the oxygen atom bridging the beta to the gamma phosphate is replaced by a nitrogen atom. It binds tightly to G-protein in the presence of Mg2+. The nucleotide is a potent stimulator of adenylate cyclase. |
Categories: Guanine Nucleotides Guanosine Triphosphate Heterocyclic Compounds, Fused-Ring Nucleic Acids, Nucleotides, and Nucleosides Nucleotides Purine Nucleotides Purines Ribonucleotides
Cross-references: BindingDB: 85784 ChEBI: 78408 CHEMBL1233085 ChemSpider: 33738 PDB: GNP PubChem:36735 PubChem:46506592 ZINC: ZINC000037868676
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q92930 | Q92930 | Ras-related protein Rab-8B | binder | targets |