Molecule Details
| InChIKey | UPBAOYRENQEPJO-UHFFFAOYSA-N |
|---|---|
| Compound Name | Distamycin A |
| Canonical SMILES | Cn1cc(NC(=O)c2cc(NC(=O)c3cc(NC=O)cn3C)cn2C)cc1C(=O)NCCC(=N)N |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.5 |
| Source | ChEMBL;BindingDB;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20261 |
|---|---|
| Drug Name | Stallimycin |
| CAS Number | 636-47-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Stallimycin is a small molecule drug. The usage of the INN stem '-mycin' in the name indicates that Stallimycin is a antibiotic, produced by Streptomyces strain. Stallimycin has a monoisotopic molecular weight of 481.22 Da. |
Categories: Amino Acids, Peptides, and Proteins Anti-Infective Agents Antiviral Agents Peptides
Cross-references: BindingDB: 50055659 CHEMBL11252 PDB: DMY ZINC: ZINC000003872327
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P03372 | ESR1 | Homo sapiens | Human | PF12743 PF00104 PF02159 PF00105 | 7.7 | IC50 | ChEMBL |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 7.7 | pIC50 | TTD_MultiTarget |
| Q92731 | ESR2 | Homo sapiens | Human | PF12497 PF00104 PF00105 | 7.7 | IC50 | ChEMBL |
| P01112 | HRAS | Homo sapiens | Human | PF00071 | 6.7 | IC50 | ChEMBL;BindingDB |
| Q96WX4 | erg6 | Pneumocystis carinii (strain B80) | Pathogen | PF08241 PF08498 | 7.7 | pIC50 | TTD_MultiTarget |