Molecule Details
| InChIKey | UOBYJVFBFSLCTQ-UHFFFAOYSA-N |
|---|---|
| Compound Name | Tmc-647055 |
| Canonical SMILES | COc1ccc2c(c1)C=C1Cn3c-2c(C2CCCCC2)c2ccc(cc23)C(=O)NS(=O)(=O)N(C)CCOCCN(C)C1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.32 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11822 |
|---|---|
| Drug Name | TMC-647055 |
| CAS Number | 1204416-97-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | TMC647055 has been used in trials studying the treatment of Hepatitis C, Chronic Hepatitis C, Hepatitis C, Chronic, and Chronic Hepatitis C Virus. |
Categories: Amides Heterocyclic Compounds, Fused-Ring Sulfones Sulfur Compounds
Cross-references: BindingDB: 243456 CHEMBL2043025 ChemSpider: 28522119 PubChem:44556044 PubChem:347828169 ZINC: ZINC000084726167
Target Activities (2)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q9WMX2 | Hepatitis C virus genotype 1b (isolate Con1) | Pathogen | PF07652 PF01543 PF01542 PF01539 PF01560 PF01538 PF01006 PF01001 PF01506 PF08300 PF08301 PF12941 PF22027 PF02907 PF00998 | 8.4 | Kd | BindingDB | |
| O39930 | NS5b | Hepacivirus hominis | Pathogen | PF00998 | 8.3 | Kd | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P26664 | Genome polyprotein | inhibitor | targets |