Molecule Details
| InChIKey | ULSDMUVEXKOYBU-ZDUSSCGKSA-N |
|---|---|
| Compound Name | Zolmitriptan |
| Canonical SMILES | CN(C)CCc1c[nH]c2ccc(C[C@H]3COC(=O)N3)cc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.1 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00315 |
|---|---|
| Drug Name | Zolmitriptan |
| CAS Number | 139264-17-8 |
| Groups | approved investigational |
| ATC Codes | N02CC03 |
| Description | Zolmitriptan is a member of the triptan class of 5-hydroxytryptamine(5-HT)<sub>1B/1D/(1F)</sub> receptor agonists used to treat acute migraine.[A462, L12978] [Sumatriptan] was the first triptan to be developed, but had poor oral bioavailability and lipophilicity. This led to the development of secon... |
Categories: Agents that produce hypertension Amines Analgesics Antidepressive Agents Antimigraine Preparations Biogenic Amines Biogenic Monoamines Central Nervous System Depressants Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 Substrates Heterocyclic Compounds, Fused-Ring Indoles Monoamine Oxidase A Substrates Nervous System Neurotransmitter Agents Oxazoles Selective Serotonin 5-HT1 Receptor Agonists Selective Serotonin Agonists Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 1b Receptor Agonists Serotonin 1d Receptor Agonists Serotonin 5-HT1 Receptor Agonists Serotonin Agents Serotonin Modulators Serotonin Receptor Agonists Serotonin-1b and Serotonin-1d Receptor Agonist Triptans
Cross-references: BindingDB: 50033383 ChEBI: 10124 CHEMBL1185 ChemSpider: 54844 Drugs Product Database (DPD): 11793 C07218 D00415 PharmGKB: PA451975 PubChem:60857 PubChem:46506452 RxCUI: 135775 Therapeutic Targets Database: DAP000077 Wikipedia: Zolmitriptan ZINC: ZINC000000015515
Target Activities (3)
DrugBank Target Actions (11)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P21397 | MAOA | Amine oxidase [flavin-containing] A | substrate | enzymes |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | agonist | targets |
| P28221 | HTR1D | 5-hydroxytryptamine receptor 1D | agonist | targets |
| P28222 | HTR1B | 5-hydroxytryptamine receptor 1B | agonist | targets |
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | agonist | targets |
| P28566 | HTR1E | 5-hydroxytryptamine receptor 1E | agonist | targets |
| P30939 | HTR1F | 5-hydroxytryptamine receptor 1F | agonist | targets |
| P34969 | HTR7 | 5-hydroxytryptamine receptor 7 | agonist | targets |
| P41595 | HTR2B | 5-hydroxytryptamine receptor 2B | agonist | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | binder | transporters |