Molecule Details
| InChIKey | UHIXWHUVLCAJQL-MPBGBICISA-N |
|---|---|
| Canonical SMILES | C[C@@H](n1cnc2cc(Cl)ccc2c1=O)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.2 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12073 |
|---|---|
| Drug Name | Albaconazole |
| CAS Number | 187949-02-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Albaconazole has been used in trials studying the basic science of Onychomycosis. |
Categories: Anti-Infective Agents Antifungal Agents Azole Antifungals Heterocyclic Compounds, Fused-Ring Stereoisomerism Triazoles
Cross-references: BindingDB: 50011477 CHEMBL298817 ChemSpider: 181045 PubChem:208952 PubChem:347828382 Wikipedia: Albaconazole ZINC: ZINC000000602086