Molecule Details
| InChIKey | UFKLYTOEMRFKAD-SHTZXODSSA-N |
|---|---|
| Canonical SMILES | CO[C@H]1CC[C@H](N2C(=O)CNc3ncc(-c4ccc(C(C)(C)O)nc4)nc32)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.33 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12570 |
|---|---|
| Drug Name | Onatasertib |
| CAS Number | 1228013-30-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Onatasertib (CC-223) has been used in trials studying the treatment and basic science of Multiple Myeloma, Glioblastoma Multiforme, HepatoCellular Carcinoma, Non-small Cell Lung Cancer, and Diffuse Large B-Cell Lymphoma, among others. |
Cross-references: BindingDB: 50092783 CHEMBL3586404 ChemSpider: 35308326 PubChem:58298316 PubChem:347828792 ZINC: ZINC000114617828
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P42345 | MTOR | Homo sapiens | Human | PF02259 PF02260 PF08771 PF23593 PF11865 PF00454 | 7.8 | IC50 | ChEMBL;BindingDB |
| P07333 | CSF1R | Homo sapiens | Human | PF00047 PF25305 PF07714 | 7.5 | IC50 | ChEMBL;BindingDB |
| Q8N122 | RPTOR | Homo sapiens | Human | PF02985 PF14538 PF00400 | 7.5 | IC50 | ChEMBL |
| Q9BVC4 | MLST8 | Homo sapiens | Human | PF00400 | 7.5 | IC50 | ChEMBL |
| Q9UBF8 | PI4KB | Homo sapiens | Human | PF00454 PF21245 | 7.4 | Kd | ChEMBL;BindingDB |
| P35916 | FLT4 | Homo sapiens | Human | PF07679 PF13927 PF22971 PF07714 PF21339 PF17988 PF22854 | 6.2 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P42345 | MTOR | Serine/threonine-protein kinase mTOR | modulator | targets |