Molecule Details
| InChIKey | UEPXBTCUIIGYCY-UHFFFAOYSA-N |
|---|---|
| Compound Name | Naporafenib |
| Canonical SMILES | Cc1ccc(NC(=O)c2ccnc(C(F)(F)F)c2)cc1-c1cc(OCCO)nc(N2CCOCC2)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.19 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB18865 |
|---|---|
| Drug Name | Naporafenib |
| CAS Number | 1800398-38-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Naporafenib is under investigation in clinical trial NCT06346067 (A Study to Assess Naporafenib (ERAS-254) Administered With Trametinib in Patients With Nras-mutant Melanoma (SEACRAFT-2)). |
Categories: Amines Antineoplastic Agents Enzyme Inhibitors Protein Kinase Inhibitors Pyridines
Cross-references: BindingDB: 88120 CHEMBL4583691 ChemSpider: 67886371 PDB: K81
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P04049 | RAF1 | Homo sapiens | Human | PF00130 PF07714 PF02196 | 9.1 | IC50 | ChEMBL;BindingDB |
| P15056 | BRAF | Homo sapiens | Human | PF00130 PF07714 PF02196 | 9.1 | IC50 | ChEMBL;BindingDB |
| Q08345 | DDR1 | Homo sapiens | Human | PF21114 PF00754 PF07714 | 8.7 | Kd | ChEMBL;BindingDB |
| Q16832 | DDR2 | Homo sapiens | Human | PF21114 PF00754 PF07714 | 8.0 | Kd | ChEMBL;BindingDB |
| P09619 | PDGFRB | Homo sapiens | Human | PF00047 PF13927 PF25305 PF07714 | 7.8 | Kd | ChEMBL;BindingDB |
| P10398 | ARAF | Homo sapiens | Human | PF00130 PF07714 PF02196 | 6.4 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P04049 | RAF1 | RAF proto-oncogene serine/threonine-protein kinase | inhibitor | targets |