Molecule Details
| InChIKey | UEJJHQNACJXSKW-UHFFFAOYSA-N |
|---|---|
| Compound Name | Thalidomide |
| Canonical SMILES | O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.54 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01041 |
|---|---|
| Drug Name | Thalidomide |
| CAS Number | 50-35-1 |
| Groups | approved investigational withdrawn |
| ATC Codes | L04AX02 |
| Description | A piperidinyl isoindole originally introduced as a non-barbiturate hypnotic, thalidomide was withdrawn from the market due to teratogenic effects. It has been reintroduced and used for a number of inflammatory disorders and cancers. Thalidomide displays immunosuppressive and anti-angiogenic activity... |
Categories: Angiogenesis Inhibitors Angiogenesis Modulating Agents Antineoplastic Agents Antineoplastic and Immunomodulating Agents Cardiotoxic antineoplastic agents Central Nervous System Depressants Cytochrome P-450 CYP1A1 Substrates Cytochrome P-450 CYP2B6 Inducers Cytochrome P-450 CYP2B6 Inducers (strength unknown) Cytochrome P-450 CYP2B6 Substrates Cytochrome P-450 CYP2C19 Inhibitors Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2C19 inhibitors (strength unknown) Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Inducers Cytochrome P-450 CYP3A5 Inducers (strength unknown) Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs causing inadvertant photosensitivity Growth Inhibitors Growth Substances Heterocyclic Compounds, Fused-Ring Hypotensive Agents Immunologic Factors Immunomodulatory Agents Immunosuppressive Agents Isoindoles Leprostatic Agents Myelosuppressive Agents Noxae Photosensitizing Agents Phthalimides Teratogens Toxic Actions Tumor Necrosis Factor Blockers
Cross-references: BindingDB: 50070114 ChEBI: 74947 CHEMBL468 ChemSpider: 5233 Drugs Product Database (DPD): 6036 C07910 D00754 PharmGKB: PA451644 PubChem:5426 PubChem:46505665 RxCUI: 10432 Therapeutic Targets Database: DAP000865 Wikipedia: Thalidomide
Target Activities (2)
DrugBank Target Actions (15)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P20813 | CYP2B6 | Cytochrome P450 2B6 | inducer | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | inducer | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | inhibitor | enzymes |
| P04798 | CYP1A1 | Cytochrome P450 1A1 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P20813 | CYP2B6 | Cytochrome P450 2B6 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | substrate | enzymes |
| P02763 | P02763 | alpha1-acid glycoprotein | binder | targets |
| P01375 | TNF | Tumor necrosis factor | inhibitor | targets |
| Q96SW2 | CRBN | Protein cereblon | inhibitor | targets |