Molecule Details
| InChIKey | UDMBCSSLTHHNCD-KQYNXXCUSA-N |
|---|---|
| Compound Name | Adenosine Monophosphate |
| Canonical SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 11 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.22 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00131 |
|---|---|
| Drug Name | Adenosine phosphate |
| CAS Number | 61-19-8 |
| Groups | approved investigational nutraceutical withdrawn |
| ATC Codes | nan |
| Description | Adenosine phosphate, or adenylic acid, is an adenine nucleotide containing one phosphate group esterified to the sugar moiety in the 2'-, 3'-, or 5'-position. Adenosine phosphate was withdrawn by the FDA since it was considered neither safe nor effective for its intended uses as a vasodi... |
Categories: Adenine Nucleotides Dietary Supplements Heterocyclic Compounds, Fused-Ring Nucleic Acids, Nucleotides, and Nucleosides Nucleotides Purine Nucleotides Purines Ribonucleotides Supplements
Cross-references: BindingDB: 18137 ChEBI: 16027 CHEMBL752 ChemSpider: 5858 C00020 D02769 PDB: AMP PharmGKB: PA164744376 PubChem:6083 PubChem:46507628 RxCUI: 309 Therapeutic Targets Database: DAP001319 Wikipedia: Adenosine_monophosphate ZINC: ZINC000003860156
Target Activities (11)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P12931 | SRC | Homo sapiens | Human | PF07714 PF00017 PF00018 | 7.0 | IC50 | ChEMBL;BindingDB |
| O43741 | PRKAB2 | Homo sapiens | Human | PF16561 PF04739 | 6.8 | Kd | ChEMBL |
| P54619 | PRKAG1 | Homo sapiens | Human | PF00571 | 6.8 | Kd | ChEMBL |
| P54646 | PRKAA2 | Homo sapiens | Human | PF16579 PF21147 PF00069 | 6.8 | Kd | ChEMBL |
| Q13131 | PRKAA1 | Homo sapiens | Human | PF16579 PF21147 PF00069 | 6.8 | Kd | ChEMBL |
| Q9UGI9 | PRKAG3 | Homo sapiens | Human | PF00571 | 6.8 | Kd | ChEMBL |
| Q9UGJ0 | PRKAG2 | Homo sapiens | Human | PF00571 | 6.8 | Kd | ChEMBL |
| Q9Y478 | PRKAB1 | Homo sapiens | Human | PF16561 PF04739 | 6.8 | Kd | ChEMBL |
| P09467 | FBP1 | Homo sapiens | Human | PF00316 PF18913 | 6.1 | IC50 | ChEMBL;BindingDB |
| P04585 | gag-pol | Human immunodeficiency virus type 1 group M subtype B (isolate HXB2) | Pathogen | PF00540 PF19317 PF00552 PF02022 PF00075 PF00665 PF00077 PF00078 PF06815 PF06817 PF00098 | 9.3 | Kd | BindingDB |
| Q72874 | pol | Human immunodeficiency virus type 1 | Pathogen | PF00077 | 9.3 | Kd | ChEMBL |
DrugBank Target Actions (14)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P07741 | APRT | Adenine phosphoribosyltransferase | substrate | enzymes |
| P23109 | AMPD1 | AMP deaminase 1 | substrate | enzymes |
| P06737 | PYGL | Glycogen phosphorylase, liver form | activator | targets |
| P16220 | P16220 | Cyclic AMP-responsive element-binding protein 1 | activator | targets |
| Q13131 | PRKAA1 | 5'-AMP-activated protein kinase | activator | targets |
| Q9Y478 | PRKAB1 | 5'-AMP-activated protein kinase subunit beta-1 | activator | targets |
| P09467 | FBP1 | Fructose-1,6-bisphosphatase 1 | antagonist | targets |
| P33121 | ACSL1 | Long-chain-fatty-acid--CoA ligase 1 | product of | targets |
| P49773 | HINT1 | Adenosine 5'-monophosphoramidase HINT1 | product of | targets |
| P55263 | ADK | Adenosine kinase | product of | targets |
| Q07343 | PDE4B | 3',5'-cyclic-AMP phosphodiesterase 4B | product of | targets |
| Q08499 | PDE4D | 3',5'-cyclic-AMP phosphodiesterase 4D | product of | targets |
| Q08828 | ADCY1 | Adenylate cyclase type 1 | product of | targets |
| Q9NR19 | Q9NR19 | Acetyl-coenzyme A synthetase, cytoplasmic | product of | targets |