Molecule Details
| InChIKey | SYTBZMRGLBWNTM-UHFFFAOYSA-N |
|---|---|
| Compound Name | Flurbiprofen |
| Canonical SMILES | CC(C(=O)O)c1ccc(-c2ccccc2)c(F)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.07 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00712 |
|---|---|
| Drug Name | Flurbiprofen |
| CAS Number | 5104-49-4 |
| Groups | approved investigational |
| ATC Codes | M02AA19 M01AE09 R02AX01 S01BC04 |
| Description | Flurbiprofen, a propionic acid derivative, is a nonsteroidal anti-inflammatory agent (NSAIA) with antipyretic and analgesic activity. Oral formulations of flurbiprofen may be used for the symptomatic treatment of rheumatoid arthritis, osteoarthritis and anklylosing spondylitis. Flurbiprofen may also... |
Categories: Acids, Acyclic Agents causing hyperkalemia Agents that produce hypertension Analgesics Analgesics, Non-Narcotic Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Anti-Inflammatory Agents, Non-Steroidal (Non-Selective) Antiinflammatory Preparations, Non-Steroids for Topical Use Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Antirheumatic Agents Arylpropionic acid NSAIDS Benzene Derivatives Biphenyl Compounds Central Nervous System Agents Cyclooxygenase Inhibitors Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 Substrates Drugs causing inadvertant photosensitivity Drugs that are Mainly Renally Excreted Enzyme Inhibitors Musculo-Skeletal System Nephrotoxic agents Non COX-2 selective NSAIDS OAT1/SLC22A6 inhibitors Ophthalmologicals Other Nonsteroidal Anti-inflammatory Agents Peripheral Nervous System Agents Photosensitizing Agents Propionates Sensory Organs Sensory System Agents Throat Preparations Topical Products for Joint and Muscular Pain UGT1A1 Inhibitors UGT1A1 Substrates UGT1A3 substrates UGT1A9 Substrates UGT2B7 substrates
Cross-references: BindingDB: 50074922 ChEBI: 5130 CHEMBL563 ChemSpider: 3277 Drugs Product Database (DPD): 1914 Guide to Pharmacology: 4194 IUPHAR: 4194 D00330 PharmGKB: PA449683 PubChem:3394 PubChem:46505550 RxCUI: 4502 Therapeutic Targets Database: DAP000621 Wikipedia: Flurbiprofen
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35354 | PTGS2 | Homo sapiens | Human | PF03098 | 8.0 | IC50 | ChEMBL;BindingDB |
| P23219 | PTGS1 | Homo sapiens | Human | PF03098 | 7.7 | IC50 | ChEMBL;BindingDB |
| P42330 | AKR1C3 | Homo sapiens | Human | PF00248 | 6.3 | IC50 | ChEMBL |
| P52895 | AKR1C2 | Homo sapiens | Human | PF00248 | 6.3 | IC50 | ChEMBL |
DrugBank Target Actions (12)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | other/unknown | carriers |
| P22309 | UGT1A1 | UDP-glucuronosyltransferase 1A1 | inhibitor | enzymes |
| O60656 | O60656 | UDP-glucuronosyltransferase 1A9 | substrate | enzymes |
| P06133 | P06133 | UDP-glucuronosyltransferase 2B4 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | substrate | enzymes |
| P22309 | UGT1A1 | UDP-glucuronosyltransferase 1A1 | substrate | enzymes |
| P35503 | P35503 | UDP-glucuronosyltransferase 1A3 | substrate | enzymes |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |
| O15439 | O15439 | ATP-binding cassette sub-family C member 4 | inhibitor | transporters |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 | inhibitor | transporters |