Molecule Details
| InChIKey | SYOKIDBDQMKNDQ-XWTIBIIYSA-N |
|---|---|
| Compound Name | Vildagliptin |
| Canonical SMILES | N#C[C@@H]1CCCN1C(=O)CNC12CC3CC(CC(O)(C3)C1)C2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.92 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04876 |
|---|---|
| Drug Name | Vildagliptin |
| CAS Number | 274901-16-5 |
| Groups | approved investigational |
| ATC Codes | A10BH02 A10BD08 |
| Description | Vildagliptin (LAF237) is an orally active antihyperglycemic agent that selectively inhibits the dipeptidyl peptidase-4 (DPP-4) enzyme. It is used to manage type II diabetes mellitus, where GLP-1 secretion and insulinotropic effects are impaired.[A232488] By inhibiting DPP-4, vildagliptin prevents th... |
Categories: Agents causing angioedema Alimentary Tract and Metabolism Blood Glucose Lowering Agents Bridged-Ring Compounds Cycloparaffins DPP-IV Inhibitors Drugs Used in Diabetes Enzyme Inhibitors Glucagon-Like Peptide 1 Nitriles Oral Hypoglycemics P-glycoprotein substrates Protease Inhibitors Pyrrolidines
Cross-references: BindingDB: 11695 ChEBI: 135285 CHEMBL142703 ChemSpider: 5293734 PharmGKB: PA165958346 PubChem:6918537 PubChem:99443227 RxCUI: 596554 Wikipedia: Vildagliptin