Molecule Details
| InChIKey | SUPRUPHAEXPGPF-QWHCGFSZSA-N |
|---|---|
| Canonical SMILES | c1cnc2c(c1)O[C@H]1CCN3CC[C@@]1(C2)C3 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.19 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12125 |
|---|---|
| Drug Name | Dianicline |
| CAS Number | 292634-27-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Dianicline has been used in trials studying the treatment of Smoking, Smoking Cessation, and Tobacco Use Cessation. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50170601 CHEMBL187927 ChemSpider: 8352269 PubChem:10176764 PubChem:347828424 Wikipedia: Dianicline ZINC: ZINC000003966685