Molecule Details
| InChIKey | SUDAHWBOROXANE-SECBINFHSA-N |
|---|---|
| Compound Name | N-((2R)-2,3-Dihydroxypropoxy)-3,4-difluoro-2-((2-fluoro-4-iodophenyl)amino)benzamide |
| Canonical SMILES | O=C(NOC[C@H](O)CO)c1ccc(F)c(F)c1Nc1ccc(I)cc1F |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.41 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB07101 |
|---|---|
| Drug Name | Mirdametinib |
| CAS Number | 391210-10-9 |
| Groups | approved investigational |
| ATC Codes | L01EE05 |
| Description | Mirdametinib is a mitogen-activated protein kinase (MAP2K, MEK, MAPKK) inhibitor. On February 11, 2025, mirdametinib was approved by the FDA for the treatment of neurofibromatosis type 1 (NF1).[L52485] NF1 is an autosomal-dominant genetic condition caused by loss-of-function variants in the _NF1_ tu... |
Categories: Acids, Carbocyclic Amides Amines Aniline Compounds Antineoplastic Agents Antineoplastic and Immunomodulating Agents BCRP/ABCG2 Substrates Benzene Derivatives Benzoates Kinase Inhibitor Mitogen-activated protein kinase (MEK) inhibitors P-glycoprotein substrates Protein Kinase Inhibitors UGT1A6 substrate UGT2B7 substrates
Cross-references: BindingDB: 104963 ChEBI: 88249 CHEMBL507361 ChemSpider: 8002271 PDB: 4BM PubChem:9826528 PubChem:99443572 RxCUI: 2705551 ZINC: ZINC000003938683
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q13233 | MAP3K1 | Homo sapiens | Human | PF21040 PF00069 PF04434 | 8.2 | IC50 | BindingDB |
| Q02750 | MAP2K1 | Homo sapiens | Human | PF00069 | 7.9 | IC50 | ChEMBL;BindingDB |
| P15056 | BRAF | Homo sapiens | Human | PF00130 PF07714 PF02196 | 7.8 | IC50 | ChEMBL;BindingDB |
| P28482 | MAPK1 | Homo sapiens | Human | PF00069 | 7.6 | IC50 | ChEMBL;BindingDB |
| P36507 | MAP2K2 | Homo sapiens | Human | PF00069 | 7.0 | IC50 | ChEMBL;BindingDB |
| Q13163 | MAP2K5 | Homo sapiens | Human | PF00564 PF00069 | 6.1 | Kd | ChEMBL |
DrugBank Target Actions (7)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | substrate | enzymes |
| P19224 | UGT1A6 | UDP-glucuronosyltransferase 1A6 | substrate | enzymes |
| Q6LAP9 | Q6LAP9 | Carboxylesterase | substrate | enzymes |
| P36507 | MAP2K2 | Dual specificity mitogen-activated protein kinase kinase 2 | binder | targets |
| Q02750 | MAP2K1 | Dual specificity mitogen-activated protein kinase kinase 1 | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |