Molecule Details
| InChIKey | SUBDBMMJDZJVOS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Prilosec |
| Canonical SMILES | COc1ccc2nc(S(=O)Cc3ncc(C)c(OC)c3C)[nH]c2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.49 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00338 |
|---|---|
| Drug Name | Omeprazole |
| CAS Number | 73590-58-6 |
| Groups | approved investigational vet_approved |
| ATC Codes | A02BC51 A02BC01 A02BD05 A02BD16 A02BD01 |
| Description | Originally approved by the FDA in 1989, omeprazole is a _proton-pump inhibitor_, used to treat gastric acid-related disorders. These disorders may include gastroesophageal reflux disease (GERD), peptic ulcer disease, and other diseases characterized by the oversecretion of gastric acid. This drug wa... |
Categories: 2-Pyridinylmethylsulfinylbenzimidazoles Acid Reducers Alimentary Tract and Metabolism Anti-Ulcer Agents BCRP/ABCG2 Inhibitors Benzimidazoles Cytochrome P-450 CYP1A1 Substrates Cytochrome P-450 CYP1A2 Inducers Cytochrome P-450 CYP1A2 Inducers (strength unknown) Cytochrome P-450 CYP2C18 Substrates Cytochrome P-450 CYP2C19 Inhibitors Cytochrome P-450 CYP2C19 Inhibitors (weak) Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (weak) Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs for Acid Related Disorders Drugs for Peptic Ulcer and Gastro-Oesophageal Reflux Disease (Gord) Enzyme Inhibitors Gastric Acid Lowering Agents Gastrointestinal Agents Heterocyclic Compounds, Fused-Ring P-glycoprotein inhibitors P-glycoprotein substrates Proton Pump Inhibitors Proton-pump Inhibitors Pyridines Sulfoxides Sulfur Compounds
Cross-references: BindingDB: 50241343 ChEBI: 77260 CHEMBL1503 ChemSpider: 4433 Drugs Product Database (DPD): 1250 Guide to Pharmacology: 4279 IUPHAR: 4279 C07324 D00455 PharmGKB: PA450704 PubChem:4594 PubChem:46509065 RxCUI: 7646 Therapeutic Targets Database: DAP000180 Wikipedia: Omeprazole
Target Activities (2)
DrugBank Target Actions (20)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P04798 | CYP1A1 | Cytochrome P450 1A1 | inducer | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | inducer | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| Q16678 | CYP1B1 | Cytochrome P450 1B1 | inducer | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | inhibitor | enzymes |
| P04798 | CYP1A1 | Cytochrome P450 1A1 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P33260 | CYP2C18 | Cytochrome P450 2C18 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P35869 | AHR | Aryl hydrocarbon receptor | agonist | targets |
| P20648 | ATP4A | Potassium-transporting ATPase alpha chain 1 | inhibitor | targets |
| P51164 | ATP4B | Potassium-transporting ATPase subunit beta | modulator | targets |
| O15438 | ABCC3 | ATP-binding cassette sub-family C member 3 | inducer | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |