Molecule Details
| InChIKey | SOYKEARSMXGVTM-HNNXBMFYSA-N |
|---|---|
| Compound Name | Dexchlorpheniramine |
| Canonical SMILES | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.76 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13679 |
|---|---|
| Drug Name | Dexchlorpheniramine |
| CAS Number | 25523-97-1 |
| Groups | investigational |
| ATC Codes | R06AB52 R06AB02 |
| Description | Dexchlorpheniramine is a potent S-enantiomer of chlorpheniramine. The salt form dexchlorpheniramine maleate as the active ingredient is available as a prescription drug indicated for adjunctive therapy for allergic and anaphylactic reactions. It is an antihistamine drug with anticholinergic (drying)... |
Categories: Agents that reduce seizure threshold Antihistamines for Systemic Use Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (strength unknown) Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Histamine Agents Histamine Antagonists Histamine H1 Antagonists Moderate Risk QTc-Prolonging Agents Neurotransmitter Agents Pyridines QTc Prolonging Agents Stereoisomerism Substituted Alkylamines
Cross-references: BindingDB: 50776830 ChEBI: 4464 CHEMBL1201353 ChemSpider: 30576 C06946 PubChem:33036 PubChem:347829309 RxCUI: 22697 Wikipedia: Dexchlorpheniramine ZINC: ZINC000000113404
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 8.7 | IC50 | ChEMBL |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 7.7 | IC50 | ChEMBL |
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 6.6 | Ki | ChEMBL |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 6.5 | Ki | ChEMBL |
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 6.2 | Ki | ChEMBL |
| P08912 | CHRM5 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| Q01959 | SLC6A3 | Homo sapiens | Human | PF00209 | 6.1 | IC50 | ChEMBL |