Molecule Details
| InChIKey | SLFGIOIONGJGRT-UHFFFAOYSA-N |
|---|---|
| Compound Name | Cyamemazine |
| Canonical SMILES | CC(CN(C)C)CN1c2ccccc2Sc2ccc(C#N)cc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 12 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.01 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09000 |
|---|---|
| Drug Name | Cyamemazine |
| CAS Number | 3546-03-0 |
| Groups | experimental |
| ATC Codes | N05AA06 |
| Description | Cyamemazine (Tercian), also known as cyamepromazine, is a typical antipsychotic drug of the phenothiazine class used primarily in the treatment of schizophrenia and psychosis-associated anxiety. Cyamemazine actually behaves like an atypical antipsychotic, due to its potent anxiolytic effects (5-HT2C... |
Categories: Anti-Anxiety Agents Antidepressive Agents Antipsychotic Agents Central Nervous System Depressants Heterocyclic Compounds, Fused-Ring Nervous System Neurotoxic agents Phenothiazines Phenothiazines With Aliphatic Side-Chain Photosensitizing Agents Psycholeptics Serotonin 5-HT1 Receptor Antagonists Serotonin 5-HT1A Receptor Antagonists Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin 5-HT2C Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists Sulfur Compounds
Cross-references: BindingDB: 86057 ChEBI: 135379 CHEMBL2104153 ChemSpider: 56597 D07307 PubChem:62865 PubChem:310264961 RxCUI: 21877 Wikipedia: Cyamemazine
Target Activities (12)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.8 | Ki | BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 8.6 | Ki | BindingDB |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 8.4 | Ki | BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 8.3 | Ki | BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 8.2 | Ki | BindingDB |
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 7.9 | Ki | BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 7.9 | Ki | BindingDB |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 7.9 | Ki | BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 7.7 | Ki | BindingDB |
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 7.5 | Ki | BindingDB |
| P08912 | CHRM5 | Homo sapiens | Human | PF00001 | 7.5 | Ki | BindingDB |
| P08172 | CHRM2 | Homo sapiens | Human | PF00001 | 7.4 | Ki | BindingDB |