Molecule Details
| InChIKey | SJFBTAPEPRWNKH-CCKFTAQKSA-N |
|---|---|
| Compound Name | Delanzomib |
| Canonical SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B(O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.23 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11956 |
|---|---|
| Drug Name | Delanzomib |
| CAS Number | 847499-27-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Delanzomib has been used in trials studying the treatment of Solid Tumors, Multiple Myeloma, and Lymphoma, Non-Hodgkin. |
Categories: Acids Acids, Noncarboxylic Amino Acids Amino Acids, Neutral Amino Acids, Peptides, and Proteins Boron Compounds Enzyme Inhibitors Protease Inhibitors Proteasome Inhibitors
Cross-references: BindingDB: 50329819 ChEBI: 141530 CHEMBL270515 ChemSpider: 23325665 PubChem:24800541 PubChem:347828281 ZINC: ZINC000169748228
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P28065 | PSMB9 | Homo sapiens | Human | PF00227 | 9.0 | IC50 | ChEMBL;BindingDB |
| P28062 | PSMB8 | Homo sapiens | Human | PF00227 | 8.5 | IC50 | ChEMBL;BindingDB |
| P28074 | PSMB5 | Homo sapiens | Human | PF00227 | 8.5 | IC50 | ChEMBL;BindingDB |
| P40306 | PSMB10 | Homo sapiens | Human | PF12465 PF00227 | 8.0 | IC50 | ChEMBL;BindingDB |
| P08311 | CTSG | Homo sapiens | Human | PF00089 | 7.9 | IC50 | ChEMBL;BindingDB |
| P20618 | PSMB1 | Homo sapiens | Human | PF00227 | 7.5 | IC50 | ChEMBL;BindingDB |