Molecule Details
| InChIKey | SHGAZHPCJJPHSC-YCNIQYBTSA-N |
|---|---|
| Compound Name | Retinoic Acid |
| Canonical SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)C(C)(C)CCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 13 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.97 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00755 |
|---|---|
| Drug Name | Tretinoin |
| CAS Number | 302-79-4 |
| Groups | approved investigational nutraceutical |
| ATC Codes | L01XF01 D10AD51 D10AD01 |
| Description | Tretinoin, also known as all-trans-retinoic acid (ATRA), is a naturally occurring derivative of [vitamin A] (retinol).[A257474] It is an oxidation product in the physiological pathway of vitamin A metabolism.[A257689] In human circulation, tretinoin is normally found at very low concentrations, appr... |
Categories: Agents that produce hypertension Alkenes Anti-Acne Preparations Anti-Acne Preparations for Topical Use Antineoplastic Agents Antineoplastic and Immunomodulating Agents Biological Factors Cardiotoxic antineoplastic agents Carotenoids Cell Stimulants and Proliferants Cyclohexanes Cyclohexenes Cycloparaffins Cytochrome P-450 CYP1A1 Substrates Cytochrome P-450 CYP2A6 Substrates Cytochrome P-450 CYP2B6 Substrates Cytochrome P-450 CYP2C18 Substrates Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP2E1 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 CYP3A7 Substrates Cytochrome P-450 Substrates Dermatologicals Diterpenes Hydrocarbons, Acyclic Hypotensive Agents Immunosuppressive Agents Keratolytic Agents Pigments, Biological Polyenes Retinoids Retinoids for Topical Use in Acne Retinoids for cancer treatment Terpenes UGT2B7 substrates Vitamin A Vitamins Vitamins (Fat Soluble)
Cross-references: BindingDB: 31883 ChEBI: 15367 CHEMBL38 ChemSpider: 392618 Drugs Product Database (DPD): 5054 C00777 D00094 PDB: REA PharmGKB: PA164746900 PubChem:5538 PubChem:46504843 RxCUI: 10753 Therapeutic Targets Database: DNC000117 Wikipedia: Tretinoin ZINC: ZINC000012358651
Target Activities (13)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P10826 | RARB | Homo sapiens | Human | PF00104 PF00105 | 7.9 | Kd | ChEMBL;BindingDB |
| P10276 | RARA | Homo sapiens | Human | PF00104 PF00105 | 7.8 | Kd | ChEMBL;BindingDB |
| P13631 | RARG | Homo sapiens | Human | PF00104 PF00105 | 7.8 | Kd | ChEMBL;BindingDB |
| P19793 | RXRA | Homo sapiens | Human | PF00104 PF11825 PF00105 | 7.4 | Kd | ChEMBL;BindingDB |
| P28702 | RXRB | Homo sapiens | Human | PF00104 PF00105 | 7.3 | Ki | ChEMBL;BindingDB |
| Q92753 | RORB | Homo sapiens | Human | PF00104 PF00105 | 6.9 | IC50 | ChEMBL;BindingDB |
| P05067 | APP | Homo sapiens | Human | PF10515 PF12924 PF12925 PF02177 PF03494 PF00014 | 6.7 | IC50 | ChEMBL;BindingDB |
| P35398 | RORA | Homo sapiens | Human | PF00104 PF00105 | 6.7 | IC50 | ChEMBL;BindingDB |
| P51449 | RORC | Homo sapiens | Human | PF00104 PF00105 | 6.7 | IC50 | ChEMBL;BindingDB |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 6.5 | IC50 | ChEMBL |
| P48443 | RXRG | Homo sapiens | Human | PF00104 PF11825 PF00105 | 6.5 | Ki | ChEMBL;BindingDB |
| P28482 | MAPK1 | Homo sapiens | Human | PF00069 | 6.2 | IC50 | ChEMBL |
| Q13526 | PIN1 | Homo sapiens | Human | PF00639 PF00397 | 6.1 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (32)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| O43174 | CYP26A1 | Cytochrome P450 26A1 | substrate | enzymes |
| P04798 | CYP1A1 | Cytochrome P450 1A1 | substrate | enzymes |
| P05181 | CYP2E1 | Cytochrome P450 2E1 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P11509 | CYP2A6 | Cytochrome P450 2A6 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | substrate | enzymes |
| P20813 | CYP2B6 | Cytochrome P450 2B6 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | substrate | enzymes |
| P33260 | CYP2C18 | Cytochrome P450 2C18 | substrate | enzymes |
| Q02928 | CYP4A11 | Cytochrome P450 4A11 | substrate | enzymes |
| P10276 | RARA | Retinoic acid receptor alpha | agonist | targets |
| P10826 | RARB | Retinoic acid receptor beta | agonist | targets |
| P13631 | RARG | Retinoic acid receptor gamma | agonist | targets |
| P19793 | RXRA | Retinoic acid receptor RXR-alpha | agonist | targets |
| P28702 | RXRB | Retinoic acid receptor RXR-beta | agonist | targets |
| P48443 | RXRG | Retinoic acid receptor RXR-gamma | agonist | targets |
| P49788 | P49788 | Retinoic acid receptor responder protein 1 | agonist | targets |
| P02753 | RBP4 | Retinol-binding protein 4 | binder | targets |
| P29762 | P29762 | Cellular retinoic acid-binding protein 1 | binder | targets |
| P31025 | P31025 | Lipocalin-1 | binder | targets |
| Q9NY56 | Q9NY56 | Odorant-binding protein 2a | binder | targets |
| Q14081 | Q14081 | Carcinoembryonic antigen | downregulator | targets |
| Q8NFJ5 | Q8NFJ5 | Retinoic acid-induced protein 3 | regulator | targets |
| O94788 | ALDH1A2 | Retinal dehydrogenase 2 | substrate | targets |
| P00352 | ALDH1A1 | Aldehyde dehydrogenase 1A1 | substrate | targets |
| Q16654 | PDK4 | [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 4, mitochondrial | upregulator | targets |
| P29373 | P29373 | Cellular retinoic acid-binding protein 2 | substrate | transporters |
| P29762 | P29762 | Cellular retinoic acid-binding protein 1 | substrate | transporters |