Molecule Details
| InChIKey | SGUAFYQXFOLMHL-UHFFFAOYSA-N |
|---|---|
| Compound Name | Labetalol |
| Canonical SMILES | CC(CCc1ccccc1)NCC(O)c1ccc(O)c(C(N)=O)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 11 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.34 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00598 |
|---|---|
| Drug Name | Labetalol |
| CAS Number | 36894-69-6 |
| Groups | approved investigational |
| ATC Codes | C07BG01 C07CG01 C07AG01 |
| Description | Labetalol is a racemic mixture of 2 diastereoisomers where dilevalol, the R,R' stereoisomer, makes up 25% of the mixture.[L7730] Labetalol is formulated as an injection or tablets to treat hypertension.[L7727,L7730] Labetalol was granted FDA approval on 1 August 1984.[L7724] |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Adrenergic beta-Antagonists Agents causing hyperkalemia Agents producing tachycardia Alcohols Alpha and Beta Blocking Agents Alpha and Beta Blocking Agents and Thiazides Amides Amines Amino Alcohols Antihypertensive Agents Antihypertensive Agents Indicated for Hypertension Autonomic Agents Beta Blocking Agents and Thiazides Bradycardia-Causing Agents Cardiovascular Agents Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (strength unknown) Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Ethanolamines Hypotensive Agents Negative Inotrope Neurotransmitter Agents Peripheral Nervous System Agents Peripheral alpha-1 blockers Salicylamides Sympathomimetics UGT1A1 Substrates UGT1A9 Substrates UGT2B7 substrates Vasodilating Agents
Cross-references: BindingDB: 25758 ChEBI: 167638 CHEMBL429 ChemSpider: 3734 Drugs Product Database (DPD): 1896 C07063 D08106 PharmGKB: PA164743150 PubChem:3869 PubChem:46505511 RxCUI: 6185 Therapeutic Targets Database: DAP000038 Wikipedia: Labetalol
Target Activities (11)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08588 | ADRB1 | Homo sapiens | Human | PF00001 | 8.1 | Kd | ChEMBL;BindingDB |
| P13945 | ADRB3 | Homo sapiens | Human | PF00001 | 8.1 | Kd | ChEMBL;BindingDB |
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 8.0 | Kd | ChEMBL;BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 7.4 | Kd | ChEMBL |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 7.4 | Kd | ChEMBL |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 7.4 | Kd | ChEMBL |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 7.4 | Kd | ChEMBL |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 7.4 | Kd | ChEMBL |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 7.1 | Kd | ChEMBL |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 6.1 | Ki | ChEMBL |
| P10635 | CYP2D6 | Homo sapiens | Human | PF00067 | 6.1 | IC50 | ChEMBL |
DrugBank Target Actions (12)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | alpha1-acid glycoprotein | substrate | carriers |
| P02768 | ALB | Albumin | substrate | carriers |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| O60656 | O60656 | UDP-glucuronosyltransferase 1A9 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | substrate | enzymes |
| P22309 | UGT1A1 | UDP-glucuronosyltransferase 1A1 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P07550 | ADRB2 | Beta-2 adrenergic receptor | antagonist | targets |
| P08588 | ADRB1 | Beta-1 adrenergic receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1 adrenergic receptors | antagonist | targets |
| Q2M3G0 | Q2M3G0 | ATP-binding cassette sub-family B member 5 | binder | transporters |