Molecule Details
| InChIKey | SECKRCOLJRRGGV-UHFFFAOYSA-N |
|---|---|
| Compound Name | Vardenafil |
| Canonical SMILES | CCCc1nc(C)c2c(=O)nc(-c3cc(S(=O)(=O)N4CCN(CC)CC4)ccc3OCC)[nH]n12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 16 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.19 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00862 |
|---|---|
| Drug Name | Vardenafil |
| CAS Number | 224785-90-4 |
| Groups | approved |
| ATC Codes | G04BE09 |
| Description | Vardenafil is a selective inhibitor of cyclic guanosine monophosphate (cGMP)-specific phosphodiesterase type 5 (PDE5) and an oral therapy for the treatment of erectile dysfunction.[L45563,L45568] During sexual stimulation, nitric oxide (NO) is released from nerve endings and endothelial cells in the... |
Categories: Cardiovascular Agents Cytochrome P-450 CYP2C19 Inhibitors Cytochrome P-450 CYP2C19 Inhibitors (weak) Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (weak) Cytochrome P-450 CYP2C9 Inhibitors Cytochrome P-450 CYP2C9 Inhibitors (weak) Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (weak) Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (weak) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs Used in Erectile Dysfunction Enzyme Inhibitors Genito Urinary System and Sex Hormones Genitourinary Agents Imidazoles P-glycoprotein inhibitors P-glycoprotein substrates Phosphodiesterase 5 Inhibitors Phosphodiesterase Inhibitors Piperazines Potential QTc-Prolonging Agents QTc Prolonging Agents Urological Agents Urologicals Vasodilating Agents
Cross-references: BindingDB: 50088373 ChEBI: 46295 CHEMBL1520 ChemSpider: 99300 Drugs Product Database (DPD): 13311 D08668 PDB: VDN PharmGKB: PA10229 PubChem:110634 PubChem:46506777 RxCUI: 306674 Therapeutic Targets Database: DAP000414 Wikipedia: Vardenafil ZINC: ZINC000018324776
Target Activities (16)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O76074 | PDE5A | Homo sapiens | Human | PF01590 PF00233 | 9.2 | IC50 | ChEMBL;BindingDB |
| O43924 | PDE6D | Homo sapiens | Human | PF05351 | 8.0 | IC50 | ChEMBL |
| P16499 | PDE6A | Homo sapiens | Human | PF01590 PF00233 | 8.0 | IC50 | ChEMBL |
| P18545 | PDE6G | Homo sapiens | Human | PF04868 | 8.0 | IC50 | ChEMBL |
| P35913 | PDE6B | Homo sapiens | Human | PF01590 PF00233 | 8.0 | IC50 | ChEMBL |
| P51160 | PDE6C | Homo sapiens | Human | PF01590 PF00233 | 8.0 | IC50 | ChEMBL;BindingDB |
| Q13956 | PDE6H | Homo sapiens | Human | PF04868 | 8.0 | IC50 | ChEMBL |
| P13569 | CFTR | Homo sapiens | Human | PF00664 PF00005 PF14396 | 6.8 | IC50 | BindingDB |
| Q9HCR9 | PDE11A | Homo sapiens | Human | PF01590 PF00233 | 6.8 | IC50 | ChEMBL;BindingDB |
| P54750 | PDE1A | Homo sapiens | Human | PF00233 PF08499 | 6.6 | IC50 | ChEMBL |
| Q14123 | PDE1C | Homo sapiens | Human | PF00233 PF08499 | 6.6 | IC50 | ChEMBL |
| Q01064 | PDE1B | Homo sapiens | Human | PF00233 PF08499 | 6.5 | IC50 | ChEMBL;BindingDB |
| O76083 | PDE9A | Homo sapiens | Human | PF00233 | 6.3 | IC50 | ChEMBL;BindingDB |
| Q13370 | PDE3B | Homo sapiens | Human | PF00233 | 6.2 | IC50 | ChEMBL;BindingDB |
| Q14432 | PDE3A | Homo sapiens | Human | PF00233 | 6.2 | IC50 | ChEMBL |
| Q9Y233 | PDE10A | Homo sapiens | Human | PF01590 PF00233 | 6.1 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (15)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | inhibitor | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P18545 | PDE6G | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma | allosteric modulator | targets |
| Q13956 | PDE6H | Retinal cone rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma | allosteric modulator | targets |
| O76074 | PDE5A | cGMP-specific 3',5'-cyclic phosphodiesterase | inhibitor | targets |
| P18545 | PDE6G | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma | inhibitor | targets |
| Q13956 | PDE6H | Retinal cone rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |