Molecule Details
| InChIKey | SBDNJUWAMKYJOX-UHFFFAOYSA-N |
|---|---|
| Compound Name | Meclofenamic Acid |
| Canonical SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)O)c1Cl |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.47 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00939 |
|---|---|
| Drug Name | Meclofenamic acid |
| CAS Number | 644-62-2 |
| Groups | approved investigational vet_approved |
| ATC Codes | M01AG04 M02AA18 |
| Description | A non-steroidal anti-inflammatory agent with antipyretic and antigranulation activities. It also inhibits prostaglandin biosynthesis. |
Categories: Acids, Carbocyclic Agents causing hyperkalemia Agents that produce hypertension Aminobenzoates Analgesics Analgesics, Non-Narcotic Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Anti-Inflammatory Agents, Non-Steroidal (Non-Selective) Antiinflammatory Preparations, Non-Steroids for Topical Use Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Antirheumatic Agents Benzene Derivatives Benzoates Cyclooxygenase Inhibitors Drugs that are Mainly Renally Excreted Enzyme Inhibitors Fenamates Musculo-Skeletal System Nephrotoxic agents Non COX-2 selective NSAIDS OAT1/SLC22A6 inhibitors Peripheral Nervous System Agents Sensory System Agents Thyroxine-binding globulin substrates Topical Products for Joint and Muscular Pain ortho-Aminobenzoates
Cross-references: BindingDB: 22971 ChEBI: 6710 CHEMBL509 ChemSpider: 3897 Drugs Product Database (DPD): 2114 C07117 D02341 PDB: JMS PharmGKB: PA450341 PubChem:4037 PubChem:46507887 RxCUI: 6678 Therapeutic Targets Database: DNC000919 Wikipedia: Meclofenamic_acid ZINC: ZINC000000001655
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35354 | PTGS2 | Homo sapiens | Human | PF03098 | 7.0 | IC50 | ChEMBL;BindingDB |
| P23219 | PTGS1 | Homo sapiens | Human | PF03098 | 6.7 | IC50 | ChEMBL;BindingDB |
| P02766 | TTR | Homo sapiens | Human | PF00576 | 6.3 | IC50 | ChEMBL;BindingDB |
| P42330 | AKR1C3 | Homo sapiens | Human | PF00248 | 6.3 | IC50 | ChEMBL;BindingDB |
| Q04828 | AKR1C1 | Homo sapiens | Human | PF00248 | 6.1 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05543 | P05543 | Thyroxine-binding globulin | substrate | carriers |
| P09917 | ALOX5 | Polyunsaturated fatty acid 5-lipoxygenase | inhibitor | targets |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |
| O43525 | KCNQ3 | Potassium voltage-gated channel subfamily KQT member 3 | other | targets |
| O43526 | KCNQ2 | Potassium voltage-gated channel subfamily KQT member 2 | other | targets |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 | inhibitor | transporters |
| Q9NYB5 | Q9NYB5 | Solute carrier organic anion transporter family member 1C1 | inhibitor | transporters |