Molecule Details
| InChIKey | RZEKVGVHFLEQIL-UHFFFAOYSA-N |
|---|---|
| Compound Name | Celecoxib |
| Canonical SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 21 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.78 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00482 |
|---|---|
| Drug Name | Celecoxib |
| CAS Number | 169590-42-5 |
| Groups | approved investigational |
| ATC Codes | N02AJ16 M01AH01 G01AE10 L01XX33 C08CA51 |
| Description | Celecoxib, a selective cyclooxygenase-2 (COX-2) inhibitor, is a nonsteroidal anti-inflammatory drug (NSAID) which is known for its decreased risk of causing gastrointestinal bleeding compared to other NSAIDS.[A181544] It is used to manage symptoms of various types of arthritis pain and in familial a... |
Categories: Agents causing hyperkalemia Agents that produce hypertension Amides Analgesics Analgesics, Non-Narcotic Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Antineoplastic and Immunomodulating Agents Antirheumatic Agents BCRP/ABCG2 Substrates BSEP/ABCB11 Inhibitors Benzene Derivatives Benzenesulfonamides COX-2 Inhibitors Central Nervous System Agents Cyclooxygenase Inhibitors Cyclooxygenase-2 (COX-2) Inhibitors Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (moderate) Cytochrome P-450 CYP2D6 Inhibitors (strength unknown) Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs causing inadvertant photosensitivity Enzyme Inhibitors Genito Urinary System and Sex Hormones Methemoglobinemia Associated Agents Musculo-Skeletal System Nephrotoxic agents P-glycoprotein substrates Peripheral Nervous System Agents Photosensitizing Agents Pyrazoles Selective Cyclooxygenase 2 Inhibitors (NSAIDs) Sensory System Agents Sulfonamides Sulfones Sulfur Compounds
Cross-references: BindingDB: 11639 ChEBI: 41423 CHEMBL118 ChemSpider: 2562 Drugs Product Database (DPD): 11865 C07589 D00567 PDB: CEL PharmGKB: PA448871 PubChem:2662 PubChem:46505596 RxCUI: 140587 Therapeutic Targets Database: DAP000737 Wikipedia: Celecoxib ZINC: ZINC000002570895
Target Activities (21)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q16790 | CA9 | Homo sapiens | Human | PF00194 | 7.8 | Ki | ChEMBL;BindingDB |
| O43570 | CA12 | Homo sapiens | Human | PF00194 | 7.7 | Ki | ChEMBL;BindingDB |
| P00918 | CA2 | Homo sapiens | Human | PF00194 | 7.7 | Ki | ChEMBL;BindingDB |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 7.7 | pIC50 | TTD_MultiTarget |
| P16050 | ALOX15 | Homo sapiens | Human | PF00305 PF01477 | 7.3 | IC50 | ChEMBL |
| P23219 | PTGS1 | Homo sapiens | Human | PF03098 | 7.2 | IC50 | ChEMBL;BindingDB |
| P35354 | PTGS2 | Homo sapiens | Human | PF03098 | 7.2 | IC50 | ChEMBL;BindingDB |
| P23280 | CA6 | Homo sapiens | Human | PF00194 | 7.0 | Ki | ChEMBL;BindingDB |
| Q9Y2D0 | CA5B | Homo sapiens | Human | PF00194 | 7.0 | Ki | ChEMBL;BindingDB |
| Q8N1Q1 | CA13 | Homo sapiens | Human | PF00194 | 7.0 | Ki | ChEMBL;BindingDB |
| P00403 | MT-CO2 | Homo sapiens | Human | PF00116 PF02790 | 6.5 | IC50 | ChEMBL;BindingDB |
| O14684 | PTGES | Homo sapiens | Human | PF01124 | 6.3 | IC50 | ChEMBL;BindingDB |
| Q9UBN7 | HDAC6 | Homo sapiens | Human | PF00850 PF02148 | 6.2 | IC50 | ChEMBL;BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| Q9ULX7 | CA14 | Homo sapiens | Human | PF00194 | 6.2 | Ki | ChEMBL;BindingDB |
| P35218 | CA5A | Homo sapiens | Human | PF00194 | 6.1 | Ki | ChEMBL;BindingDB |
| Q16539 | MAPK14 | Homo sapiens | Human | PF00069 | 6.1 | IC50 | ChEMBL;BindingDB |
| P22748 | CA4 | Homo sapiens | Human | PF00194 | 6.1 | Ki | ChEMBL;BindingDB |
| P10635 | CYP2D6 | Homo sapiens | Human | PF00067 | 6.0 | IC50 | ChEMBL |
| P53615 | NCE103 | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) | Pathogen | PF00484 | 7.0 | Ki | ChEMBL;BindingDB |
| P9WPJ9 | mtcA2 | Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) | Pathogen | PF00484 | 6.2 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (17)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| O15530 | PDPK1 | 3-phosphoinositide-dependent protein kinase 1 | inhibitor | targets |
| P00918 | CA2 | Carbonic anhydrase 2 | inhibitor | targets |
| P07451 | CA3 | Carbonic anhydrase 3 | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |
| P40763 | STAT3 | Signal transducer and activator of transcription 3 | inhibitor | targets |
| P55287 | P55287 | Cadherin-11 | inhibitor | targets |
| Q99519 | Q99519 | Sialidase-1 | inhibitor | targets |
| O15439 | O15439 | ATP-binding cassette sub-family C member 4 | inhibitor | transporters |
| O95342 | ABCB11 | Bile salt export pump | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |