Molecule Details
| InChIKey | RXWNCPJZOCPEPQ-NVWDDTSBSA-N |
|---|---|
| Compound Name | Puromycin |
| Canonical SMILES | COc1ccc(C[C@H](N)C(=O)N[C@H]2[C@@H](O)[C@H](n3cnc4c(N(C)C)ncnc43)O[C@@H]2CO)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 55 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.05 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08437 |
|---|---|
| Drug Name | Puromycin |
| CAS Number | 53-79-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Puromycin is an antibiotic that prevents bacterial protein translation. It is utilized as a selective agent in laboratory cell cultures. Puromycin is toxic to both prokaryotic and eukaryotic cells, resulting in significant cell death at appropriate doses. |
Categories: Acids, Carbocyclic Agents that produce neuromuscular block (indirect) Aminoglycoside Antibacterials Anti-Bacterial Agents Anti-Infective Agents Antimetabolites Antineoplastic Agents Antiparasitic Agents Antiprotozoals Carbohydrates Cinnamates Enzyme Inhibitors Glycosides Heterocyclic Compounds, Fused-Ring Nephrotoxic agents Noxae Nucleic Acids, Nucleotides, and Nucleosides Nucleosides Protein Synthesis Inhibitors Purine Nucleosides Purines Toxic Actions Trypanocidal Agents
Cross-references: BindingDB: 50277158 ChEBI: 17939 CHEMBL469912 ChemSpider: 388623 C01610 PDB: PUY PubChem:439530 PubChem:99444908 Wikipedia: Puromycin ZINC: ZINC000053147179
Target Activities (55)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P02358 | rpsF | Escherichia coli (strain K12) | Pathogen | PF01250 | 6.0 | IC50 | ChEMBL |
| P02359 | rpsG | Escherichia coli (strain K12) | Pathogen | PF00177 | 6.0 | IC50 | ChEMBL |
| P02413 | rplO | Escherichia coli (strain K12) | Pathogen | PF00828 | 6.0 | IC50 | ChEMBL |
| P0A7J3 | rplJ | Escherichia coli (strain K12) | Pathogen | PF00466 | 6.0 | IC50 | ChEMBL |
| P0A7J7 | rplK | Escherichia coli (strain K12) | Pathogen | PF00298 PF03946 | 6.0 | IC50 | ChEMBL |
| P0A7K2 | rplL | Escherichia coli (strain K12) | Pathogen | PF00542 PF16320 | 6.0 | IC50 | ChEMBL |
| P0A7K6 | rplS | Escherichia coli (strain K12) | Pathogen | PF01245 | 6.0 | IC50 | ChEMBL |
| P0A7L0 | rplA | Escherichia coli (strain K12) | Pathogen | PF00687 | 6.0 | IC50 | ChEMBL |
| P0A7L3 | rplT | Escherichia coli (strain K12) | Pathogen | PF00453 | 6.0 | IC50 | ChEMBL |
| P0A7L8 | rpmA | Escherichia coli (strain K12) | Pathogen | PF01016 | 6.0 | IC50 | ChEMBL |
| P0A7M2 | rpmB | Escherichia coli (strain K12) | Pathogen | PF00830 | 6.0 | IC50 | ChEMBL |
| P0A7M6 | rpmC | Escherichia coli (strain K12) | Pathogen | PF00831 | 6.0 | IC50 | ChEMBL |
| P0A7M9 | rpmE | Escherichia coli (strain K12) | Pathogen | PF01197 | 6.0 | IC50 | ChEMBL |
| P0A7N1 | ykgM | Escherichia coli (strain K12) | Pathogen | PF01197 | 6.0 | IC50 | ChEMBL |
| P0A7N4 | rpmF | Escherichia coli (strain K12) | Pathogen | PF01783 | 6.0 | IC50 | ChEMBL |
| P0A7N9 | rpmG | Escherichia coli (strain K12) | Pathogen | PF00471 | 6.0 | IC50 | ChEMBL |
| P0A7P5 | rpmH | Escherichia coli (strain K12) | Pathogen | PF00468 | 6.0 | IC50 | ChEMBL |
| P0A7Q1 | rpmI | Escherichia coli (strain K12) | Pathogen | PF01632 | 6.0 | IC50 | ChEMBL |
| P0A7Q6 | rpmJ | Escherichia coli (strain K12) | Pathogen | PF00444 | 6.0 | IC50 | ChEMBL |
| P0A7R5 | rpsJ | Escherichia coli (strain K12) | Pathogen | PF00338 | 6.0 | IC50 | ChEMBL |
| P0A7R9 | rpsK | Escherichia coli (strain K12) | Pathogen | PF00411 | 6.0 | IC50 | ChEMBL |
| P0A7S3 | rpsL | Escherichia coli (strain K12) | Pathogen | PF00164 | 6.0 | IC50 | ChEMBL |
| P0A7S9 | rpsM | Escherichia coli (strain K12) | Pathogen | PF00416 | 6.0 | IC50 | ChEMBL |
| P0A7T3 | rpsP | Escherichia coli (strain K12) | Pathogen | PF00886 | 6.0 | IC50 | ChEMBL |
| P0A7T7 | rpsR | Escherichia coli (strain K12) | Pathogen | PF01084 | 6.0 | IC50 | ChEMBL |
| P0A7U3 | rpsS | Escherichia coli (strain K12) | Pathogen | PF00203 | 6.0 | IC50 | ChEMBL |
| P0A7U7 | rpsT | Escherichia coli (strain K12) | Pathogen | PF01649 | 6.0 | IC50 | ChEMBL |
| P0A7V0 | rpsB | Escherichia coli (strain K12) | Pathogen | PF00318 | 6.0 | IC50 | ChEMBL |
| P0A7V3 | rpsC | Escherichia coli (strain K12) | Pathogen | PF07650 PF00189 | 6.0 | IC50 | ChEMBL |
| P0A7V8 | rpsD | Escherichia coli (strain K12) | Pathogen | PF00163 PF01479 | 6.0 | IC50 | ChEMBL |
| P0A7W1 | rpsE | Escherichia coli (strain K12) | Pathogen | PF00333 PF03719 | 6.0 | IC50 | ChEMBL |
| P0A7W7 | rpsH | Escherichia coli (strain K12) | Pathogen | PF00410 | 6.0 | IC50 | ChEMBL |
| P0A7X3 | rpsI | Escherichia coli (strain K12) | Pathogen | PF00380 | 6.0 | IC50 | ChEMBL |
| P0AA10 | rplM | Escherichia coli (strain K12) | Pathogen | PF00572 | 6.0 | IC50 | ChEMBL |
| P0ADY3 | rplN | Escherichia coli (strain K12) | Pathogen | PF00238 | 6.0 | IC50 | ChEMBL |
| P0ADY7 | rplP | Escherichia coli (strain K12) | Pathogen | PF00252 | 6.0 | IC50 | ChEMBL |
| P0ADZ0 | rplW | Escherichia coli (strain K12) | Pathogen | PF00276 | 6.0 | IC50 | ChEMBL |
| P0ADZ4 | rpsO | Escherichia coli (strain K12) | Pathogen | PF00312 | 6.0 | IC50 | ChEMBL |
| P0AG44 | rplQ | Escherichia coli (strain K12) | Pathogen | PF01196 | 6.0 | IC50 | ChEMBL |
| P0AG48 | rplU | Escherichia coli (strain K12) | Pathogen | PF00829 | 6.0 | IC50 | ChEMBL |
| P0AG51 | rpmD | Escherichia coli (strain K12) | Pathogen | PF00327 | 6.0 | IC50 | ChEMBL |
| P0AG55 | rplF | Escherichia coli (strain K12) | Pathogen | PF00347 | 6.0 | IC50 | ChEMBL |
| P0AG59 | rpsN | Escherichia coli (strain K12) | Pathogen | PF00253 | 6.0 | IC50 | ChEMBL |
| P0AG63 | rpsQ | Escherichia coli (strain K12) | Pathogen | PF00366 | 6.0 | IC50 | ChEMBL |
| P0AG67 | rpsA | Escherichia coli (strain K12) | Pathogen | PF00575 | 6.0 | IC50 | ChEMBL |
| P0C018 | rplR | Escherichia coli (strain K12) | Pathogen | PF00861 | 6.0 | IC50 | ChEMBL |
| P60422 | rplB | Escherichia coli (strain K12) | Pathogen | PF03947 PF00181 | 6.0 | IC50 | ChEMBL |
| P60438 | rplC | Escherichia coli (strain K12) | Pathogen | PF00297 | 6.0 | IC50 | ChEMBL |
| P60624 | rplX | Escherichia coli (strain K12) | Pathogen | PF00467 PF17136 | 6.0 | IC50 | ChEMBL |
| P60723 | rplD | Escherichia coli (strain K12) | Pathogen | PF00573 | 6.0 | IC50 | ChEMBL |
| P61175 | rplV | Escherichia coli (strain K12) | Pathogen | PF00237 | 6.0 | IC50 | ChEMBL |
| P62399 | rplE | Escherichia coli (strain K12) | Pathogen | PF00281 PF00673 | 6.0 | IC50 | ChEMBL |
| P68679 | rpsU | Escherichia coli (strain K12) | Pathogen | PF01165 | 6.0 | IC50 | ChEMBL |
| P68919 | rplY | Escherichia coli (strain K12) | Pathogen | PF01386 | 6.0 | IC50 | ChEMBL |
| Q2EEQ2 | ykgO | Escherichia coli (strain K12) | Pathogen | PF00444 | 6.0 | IC50 | ChEMBL |
DrugBank Target Actions (13)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P0A8P1 | P0A8P1 | Leucyl/phenylalanyl-tRNA--protein transferase | binder | targets |
| P39023 | RPL3 | Large ribosomal subunit protein uL3 | binder | targets |
| P40429 | RPL13A | Large ribosomal subunit protein uL13 | binder | targets |
| P61313 | RPL15 | Large ribosomal subunit protein eL15 | binder | targets |
| P61927 | RPL37 | Large ribosomal subunit protein eL37 | binder | targets |
| P62750 | RPL23A | Large ribosomal subunit protein uL23 | binder | targets |
| P62829 | RPL23 | Large ribosomal subunit protein uL14 | binder | targets |
| P62913 | RPL11 | Large ribosomal subunit protein uL5 | binder | targets |
| P62917 | RPL8 | Large ribosomal subunit protein uL2 | binder | targets |
| P84098 | RPL19 | Large ribosomal subunit protein eL19 | binder | targets |
| Q96L21 | Q96L21 | Ribosomal protein uL16-like | binder | targets |
| Q9UHA3 | Q9UHA3 | Probable ribosome biogenesis protein RLP24 | binder | targets |
| Q9UNX3 | Q9UNX3 | Ribosomal protein uL24-like | binder | targets |