Molecule Details
| InChIKey | RRRUXBQSQLKHEL-UHFFFAOYSA-N |
|---|---|
| Compound Name | Piclamilast |
| Canonical SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1OC1CCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.0 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01791 |
|---|---|
| Drug Name | Piclamilast |
| CAS Number | 144035-83-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Piclamilast (RP-73,401), is a selective PDE4 inhibitor comparable to other PDE4 inhibitors for its anti-inflammatory effects. It has been investigated for its applications to the treatment of conditions such as chronic obstructive pulmonary disease, bronchopulmonary dysplasia and asthma. The structu... |
Categories: Acids, Carbocyclic Amides Benzene Derivatives Benzoates Enzyme Inhibitors Phosphodiesterase 4 Inhibitors Phosphodiesterase Inhibitors
Cross-references: BindingDB: 14775 ChEBI: 47619 CHEMBL42126 ChemSpider: 136184 D05474 PDB: PIL PubChem:154575 PubChem:46508612 Wikipedia: Piclamilast ZINC: ZINC000000598965
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 9.0 | IC50 | ChEMBL;BindingDB |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 9.0 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 9.0 | IC50 | ChEMBL;BindingDB |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 9.0 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (4)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q08493 | PDE4C | 3',5'-cyclic-AMP phosphodiesterase 4C | binder | targets |
| P27815 | PDE4A | 3',5'-cyclic-AMP phosphodiesterase 4A | inhibitor | targets |
| Q07343 | PDE4B | 3',5'-cyclic-AMP phosphodiesterase 4B | inhibitor | targets |
| Q08499 | PDE4D | 3',5'-cyclic-AMP phosphodiesterase 4D | inhibitor | targets |