Molecule Details
| InChIKey | RPYWXZCFYPVCNQ-RVDMUPIBSA-N |
|---|---|
| Compound Name | (3E)-3-((2,4-Dimethoxyphenyl)methylene)-3,4,5,6-tetrahydro-2,3'-bipyridine |
| Canonical SMILES | COc1ccc(/C=C2\CCCN=C2c2cccnc2)c(OC)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.13 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05708 |
|---|---|
| Drug Name | GTS-21 |
| CAS Number | 148372-04-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | GTS-21 (also known as DMBX-A), is a novel, small-molecule, orally active and selective alpha-7 nicotinic acetylcholine (nACh) receptor agonist that has demonstrated memory and cognition enhancement activity in human clinical trials. Athenagen licensed the exclusive rights to the compound and a relat... |
Categories: Benzene Derivatives Cholinergic Agents Cholinergic Agonists Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2E1 Substrates Cytochrome P-450 Substrates Neurotransmitter Agents Nicotinic Agonists
Cross-references: BindingDB: 50061564 CHEMBL134713 ChemSpider: 4470526 PDB: ZY7 PubChem:5310985 PubChem:175427027 Wikipedia: GTS-21 ZINC: ZINC000000000860