Molecule Details
| InChIKey | ROTWSDMXHVGAHZ-QZTJIDSGSA-N |
|---|---|
| Compound Name | Atuliflapon |
| Canonical SMILES | Cc1cc(-c2ccc(C(=O)[C@@H]3CCCC[C@H]3C(=O)Nc3cnn4c3C(=O)NCC4)cc2)n[nH]1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.2 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19029 |
|---|---|
| Drug Name | Atuliflapon |
| CAS Number | 2041075-86-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Atuliflapon is under investigation in clinical trial NCT05251259 (Study to Assess the Efficacy and Safety of Atuliflapon in Moderate-to-severe Uncontrolled Asthma). |
Cross-references: BindingDB: 50524102 CHEMBL4542281 ChemSpider: 88297158