Molecule Details
| InChIKey | RMEDXOLNCUSCGS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Droperidol |
| Canonical SMILES | O=C(CCCN1CC=C(n2c(=O)[nH]c3ccccc32)CC1)c1ccc(F)cc1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 17 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.13 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00450 |
|---|---|
| Drug Name | Droperidol |
| CAS Number | 548-73-2 |
| Groups | approved investigational vet_approved |
| ATC Codes | N05AD08 |
| Description | A butyrophenone with general properties similar to those of haloperidol. It is used in conjunction with an opioid analgesic such as fentanyl to maintain the patient in a calm state of neuroleptanalgesia with indifference to surroundings but still able to cooperate with the surgeon. It is also used a... |
Categories: Adjuvants, Anesthesia Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Antiemetics Antipsychotic Agents Antipsychotic Agents (First Generation [Typical]) Autonomic Agents Benzimidazoles Butyrophenone Derivatives Butyrophenones Central Nervous System Agents Central Nervous System Depressants Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists Gastrointestinal Agents Heterocyclic Compounds, Fused-Ring Ketones Miscellaneous Anxiolytics Sedatives and Hypnotics Moderate Risk QTc-Prolonging Agents Nervous System Neurotoxic agents Neurotransmitter Agents Peripheral Nervous System Agents Psycholeptics Psychotropic Drugs QTc Prolonging Agents Tranquilizing Agents
Cross-references: BindingDB: 50017705 ChEBI: 4717 CHEMBL1108 ChemSpider: 3056 Drugs Product Database (DPD): 10123 D00308 PDB: USS PharmGKB: PA449422 PubChem:3168 PubChem:46505291 RxCUI: 3648 Therapeutic Targets Database: DAP000412 Wikipedia: Droperidol ZINC: ZINC000019796080
Target Activities (17)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 9.1 | Ki | ChEMBL;BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 9.1 | Ki | BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.9 | IC50 | ChEMBL |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 8.8 | IC50 | ChEMBL |
| Q12809 | KCNH2 | Homo sapiens | Human | PF00027 PF00520 PF13426 | 7.5 | IC50 | ChEMBL;BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 7.4 | pIC50 | TTD_MultiTarget |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 7.2 | IC50 | ChEMBL |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.8 | IC50 | ChEMBL |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.6 | Ki | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.5 | IC50 | ChEMBL |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P35498 | SCN1A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 6.1 | IC50 | ChEMBL;BindingDB |
| Q99250 | SCN2A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 6.1 | IC50 | ChEMBL |
| Q9NY46 | SCN3A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 6.1 | IC50 | ChEMBL |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |